![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[TXT]](/icons/text.gif) | vaksin-zifivax.html | 2026-08-10 02:09 | 107K | |
![[TXT]](/icons/text.gif) | prinsip-general-average.html | 2026-08-10 02:09 | 45K | |
![[TXT]](/icons/text.gif) | pembebanan-jaminan-fidusia-atas-polis-asuransi.html | 2026-08-10 02:09 | 44K | |
![[TXT]](/icons/text.gif) | part-i-proteksi-kepada-perusahaan-pelayaran-dari-dampak-covid-19.html | 2026-08-10 02:09 | 48K | |
![[TXT]](/icons/text.gif) | part-1-3-indeks-sektoral-yang-memiliki-kinerja-positif-tertinggi-di-bursa-efek-indonesia-tahun-2019.html | 2026-08-10 02:09 | 77K | |
![[TXT]](/icons/text.gif) | overdosis-kafein.html | 2026-08-10 02:09 | 108K | |
![[TXT]](/icons/text.gif) | menghitung-daya-tarik-tug-dan-beban-barge-untuk-kelaikan-towing-operation.html | 2026-08-10 02:09 | 62K | |
![[TXT]](/icons/text.gif) | mengenal-risiko-data-center.html | 2026-08-10 02:09 | 47K | |
![[TXT]](/icons/text.gif) | mau-tidur-siang-ternyata-ada-aturannya-lho.html | 2026-08-10 02:09 | 109K | |
![[TXT]](/icons/text.gif) | mari-mengenal-kanker-dan-survival-rate.html | 2026-08-10 02:09 | 61K | |
![[TXT]](/icons/text.gif) | layanan-pinjam-meminjam-efek-di-pasar-modal-indonesia-securities-lending-and-borrowing.html | 2026-08-10 02:09 | 51K | |
![[TXT]](/icons/text.gif) | Yahya Harahap. 2016. Hukum Perseroan Terbatas. Jakarta_ Sinar Grafika.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Undang Undang No-2.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Medyanik, O. (2021). Financial Anxiety as a Factor in Insurance Behavior. IV International Scientific and Practical Conference (pp. 1-7).html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Kitab Undang-Undang Hukum Perdata-2.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | peradilan-anak-di-indonesia.html | 2026-08-10 02:09 | 53K | |
![[TXT]](/icons/text.gif) | pembangkit-listrik-tenaga-gas-pltg-atau-gas-power-plant.html | 2026-08-10 02:09 | 52K | |
![[TXT]](/icons/text.gif) | particulate-matter-pm-25.html | 2026-08-10 02:09 | 41K | |
![[TXT]](/icons/text.gif) | emboli-paru-dan-tragedi-perayaan-halloween-di-itaewon.html | 2026-08-10 02:09 | 115K | |
![[TXT]](/icons/text.gif) | benign-prostatic-hyperplasia.html | 2026-08-10 02:09 | 106K | |
![[TXT]](/icons/text.gif) | benarkah-vape-tidak-berbahaya.html | 2026-08-10 02:09 | 105K | |
![[TXT]](/icons/text.gif) | ada-apa-dengan-nasi.html | 2026-08-10 02:09 | 106K | |
![[TXT]](/icons/text.gif) | World Nuclear Association. 2016ce0e.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Kitab Undang-Undang Hukum Acara Pidana.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Bradley, P., 2013. Cities of Vesuvius_ Pompeii and Herculaneum. Cambridge University Press.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | the-pdp-law-era-and-cyber-protection-urgency.html | 2026-08-10 02:09 | 44K | |
![[TXT]](/icons/text.gif) | persitiwa-setelah-tanggal-pelaporan.html | 2026-08-10 02:09 | 57K | |
![[TXT]](/icons/text.gif) | ngeri-ngeri-sedap-3-treaty-compression-pecah-ban-ala-reasuransi.html | 2026-08-10 02:09 | 44K | |
![[TXT]](/icons/text.gif) | mengenal-photokeratitis-ketika-matahari-menyebabkan-dampak-negatif-pada-mata.html | 2026-08-10 02:09 | 109K | |
![[TXT]](/icons/text.gif) | isolasi-mandiri-pada-covid-19.html | 2026-08-10 02:09 | 108K | |
![[TXT]](/icons/text.gif) | internal-wave-perairan-indonesia-tengah.html | 2026-08-10 02:09 | 44K | |
![[TXT]](/icons/text.gif) | faedah-pemberian-terapi-plasma-konvalesen-bagi-penderita-covid-19.html | 2026-08-10 02:09 | 109K | |
![[TXT]](/icons/text.gif) | e-service-wajah-baru-indonesiare.html | 2026-08-10 02:09 | 43K | |
![[TXT]](/icons/text.gif) | Waluyo & Gunawan (2015) Risk Based Behavioral Safety_ Membangun Kebersamaan Untuk Mewujudkan Keunggulan Operasi. Jakarta_ PT Gramedia Pustaka Utama.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | vaksin-inavac.html | 2026-08-10 02:09 | 111K | |
![[TXT]](/icons/text.gif) | perbedaan-istilah-hukum-pro-bono-dan-pro-deo.html | 2026-08-10 02:09 | 53K | |
![[TXT]](/icons/text.gif) | penggunaan-masker-dalam-kehidupan-normal-baru.html | 2026-08-10 02:09 | 113K | |
![[TXT]](/icons/text.gif) | nuclear-nerds-jenis-reaktor-dalam-pembangkit-listrik-tenaga-nuklir.html | 2026-08-10 02:09 | 45K | |
![[TXT]](/icons/text.gif) | mengenal-virus-langya-dan-potensi-emerging-disease.html | 2026-08-10 02:09 | 110K | |
![[TXT]](/icons/text.gif) | kemunculan-kasus-mpox-kedua-apakah-berpotensi-menjadi-epidemi-baru-di-indonesia.html | 2026-08-10 02:09 | 113K | |
![[TXT]](/icons/text.gif) | kanker-nasofaring.html | 2026-08-10 02:09 | 66K | |
![[TXT]](/icons/text.gif) | dapatkah-saksi-di-persidangan-dijatuhi-hukuman-pidana.html | 2026-08-10 02:09 | 55K | |
![[TXT]](/icons/text.gif) | csr.html | 2026-08-10 02:09 | 46K | |
![[DIR]](/icons/folder.gif) | World Economic Forum (WEF). (2023). Cybersecurity Futures in Financial Services. Retrieved from https_/ | 2026-08-10 02:09 | - | |
![[TXT]](/icons/text.gif) | Kitab Undang-undang Hukum Acara Perdata.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | transplantasi-ginjal.html | 2026-08-10 02:09 | 62K | |
![[TXT]](/icons/text.gif) | the-history-of-basel-committee-on-banking-supervision-bcbs.html | 2026-08-10 02:09 | 41K | |
![[TXT]](/icons/text.gif) | sirosis-hati.html | 2026-08-10 02:09 | 109K | |
![[TXT]](/icons/text.gif) | serba-serbi-jamu.html | 2026-08-10 02:09 | 115K | |
![[TXT]](/icons/text.gif) | prinsip-sewa-menurut-psak-73.html | 2026-08-10 02:09 | 52K | |
![[TXT]](/icons/text.gif) | pentingnya-etika-bisnis.html | 2026-08-10 02:09 | 55K | |
![[TXT]](/icons/text.gif) | pengaruh-foreign-account-tax-compliance-fatca-di-indonesia.html | 2026-08-10 02:09 | 41K | |
![[TXT]](/icons/text.gif) | mengenal-iqos.html | 2026-08-10 02:09 | 108K | |
![[TXT]](/icons/text.gif) | gejolak-di-pasar-saham-dan-safe-haven-assets.html | 2026-08-10 02:09 | 52K | |
![[TXT]](/icons/text.gif) | chronic-kidney-disease.html | 2026-08-10 02:09 | 64K | |
![[DIR]](/icons/folder.gif) | Kasus Studi_ UnitedHealth Group/ | 2026-08-10 02:09 | - | |
![[TXT]](/icons/text.gif) | Ikatan Akuntansi Indonesia (IAI). 2020. Pernyataan Standar Akuntansi Keuangan (PSAK) No 109_ Instrumen Keuangan .html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Hadi, S. dan Radjawane, I. M. (2009) Arus Laut. Institut Teknologi Bandung.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Hackman, J., & Wageman, R. (1995). Total Quality Management _ Empirical, Conceptual, and Practical Issues. Administrative Science Quarterly, 40(2), 309-342.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | 3.Cianjur Kembali Diguncang Gempa. Cantika Adinda Putri. cnbcindonesia.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | strategi-indonesia-dalam-menghadapi-era-ageing-population.html | 2026-08-10 02:09 | 115K | |
![[TXT]](/icons/text.gif) | spinal-cord-injury.html | 2026-08-10 02:09 | 113K | |
![[TXT]](/icons/text.gif) | serba-serbi-kurang-tidur.html | 2026-08-10 02:09 | 107K | |
![[TXT]](/icons/text.gif) | part-2-3-indeks-sektoral-yang-memiliki-kinerja-negatif-terendah-di-bursa-efek-indonesia-tahun-2019.html | 2026-08-10 02:09 | 66K | |
![[TXT]](/icons/text.gif) | mengenal-sengketa-tata-usaha-negara-3.html | 2026-08-10 02:09 | 57K | |
![[TXT]](/icons/text.gif) | ledakan-amonium-nitrat.html | 2026-08-10 02:09 | 44K | |
![[TXT]](/icons/text.gif) | kepailitan-berdasarkan-hukum-indonesia.html | 2026-08-10 02:09 | 54K | |
![[TXT]](/icons/text.gif) | impairment.html | 2026-08-10 02:09 | 42K | |
![[TXT]](/icons/text.gif) | crowdfunding-sebagai-alternatif-solusi-pendanaan-usaha.html | 2026-08-10 02:09 | 51K | |
![[TXT]](/icons/text.gif) | Peraturan Pemerintah No-3.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Medyanik, O., & Deyneka, O. (2019). Russian Citizens’ Attitude toward Insurance Policies as a Factor of Individual Economic Security. Behavioral Sciences, 10(1), 23.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | vertigo-dan-menieres-disease.html | 2026-08-10 02:09 | 110K | |
![[TXT]](/icons/text.gif) | the-ai-watershed-moment-dan-implikasinya-terhadap-industri-asuransi-global.html | 2026-08-10 02:09 | 43K | |
![[TXT]](/icons/text.gif) | perbedaan-cessie-novasi-dan-subrogasi.html | 2026-08-10 02:09 | 55K | |
![[TXT]](/icons/text.gif) | pengembangan-vaksin-covid-19-di-indonesia.html | 2026-08-10 02:09 | 107K | |
![[TXT]](/icons/text.gif) | mengenal-water-hammer-si-ancaman-kendaraan-di-musim-hujan.html | 2026-08-10 02:09 | 44K | |
![[TXT]](/icons/text.gif) | mengenal-london-engineering-group-defects-clause.html | 2026-08-10 02:09 | 55K | |
![[TXT]](/icons/text.gif) | mengenal-gerd.html | 2026-08-10 02:09 | 114K | |
![[TXT]](/icons/text.gif) | Wilson, Ed1fd.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Snafi, A. E. 2016. Pharmacological Importances of Clitoria ternatea – a review. IOSR J. Pharm, 6_ 68-83.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Press Statement _ CND votes on recommendations for cannabis and cannabis-related substances, UN Commission on Narcotic Drugs (CND), Dec 2, 2020.html | 2026-08-10 02:09 | 4.4K | |
![[DIR]](/icons/folder.gif) | Perro Pet (2018). Laws About Owning Pets in Singapore. Retrieved from https_/ | 2026-08-10 02:09 | - | |
![[TXT]](/icons/text.gif) | Intergovernmental Panel on Climate Change, 2000. Land Use, Land-Use Change and Forestry. s.l._s.n.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | ENVIRONMENTAL, SOCIAL AND GOVERNANCE (ESG)_ Governance, Risk Management and Compliance (GRC).html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | son-of-omricon.html | 2026-08-10 02:09 | 109K | |
![[TXT]](/icons/text.gif) | pre-diabetes-akankah-menjadi-diabetes.html | 2026-08-10 02:09 | 114K | |
![[TXT]](/icons/text.gif) | memahami-fenomena-bonus-demografi-dan-pengaruhnya-pada-industri-asuransi-jiwa.html | 2026-08-10 02:09 | 120K | |
![[TXT]](/icons/text.gif) | gunung-api-di-indonesia-dan-bahaya-yang-ditimbulkan.html | 2026-08-10 02:09 | 44K | |
![[TXT]](/icons/text.gif) | gempa-lombok-2018.html | 2026-08-10 02:09 | 45K | |
![[TXT]](/icons/text.gif) | eclampsia.html | 2026-08-10 02:09 | 105K | |
![[TXT]](/icons/text.gif) | currency-fluctuation-clause-bagian-i.html | 2026-08-10 02:09 | 42K | |
![[TXT]](/icons/text.gif) | campak-kembali-mengancam-tren-insidensi-di-indonesia-dan-potensi-wabah-di-masa-mendatang.html | 2026-08-10 02:09 | 116K | |
![[TXT]](/icons/text.gif) | NDA. 2024b267.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | H. Salim HS, SH., M.S.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | strategi-deutsche-bank-ag-dan-kinerja-sahamnya.html | 2026-08-10 02:09 | 56K | |
![[TXT]](/icons/text.gif) | potensi-natcat-risk-pada-asuransi-carear.html | 2026-08-10 02:09 | 40K | |
![[TXT]](/icons/text.gif) | penggunaan-kendaraan-listrik-dari-perspektif-kesehatan-dan-lingkungan.html | 2026-08-10 02:09 | 114K | |
![[TXT]](/icons/text.gif) | malaria.html | 2026-08-10 02:09 | 60K | |
![[TXT]](/icons/text.gif) | kilas-balik-penanganan-covid-19-di-indonesia.html | 2026-08-10 02:09 | 116K | |
![[TXT]](/icons/text.gif) | insurtech-a-growing-synergy-between-insurance-technology-and-healthcare.html | 2026-08-10 02:09 | 110K | |
![[TXT]](/icons/text.gif) | infectious-disease-exclusion-clause-lsw-1191.html | 2026-08-10 02:09 | 43K | |
![[TXT]](/icons/text.gif) | burglary-insurance.html | 2026-08-10 02:09 | 41K | |
![[TXT]](/icons/text.gif) | R. Subekti dan R. Tjitrosudibio. (1992). Kitab Undang-Undang Hukum Perdata, Terjemahan Jakarta_ PT. Pradnya Paramita.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Handbook of Commodity Profile “Indonesian Essential Oils_ The Scents of Natural life” milik Kementrian Perdagangan Republik Indonesia Tahun 2011.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | vaksin-indovac.html | 2026-08-10 02:09 | 112K | |
![[TXT]](/icons/text.gif) | mengenal-varian-p1-dari-sars-cov-2.html | 2026-08-10 02:09 | 111K | |
![[TXT]](/icons/text.gif) | implementasi-psak-65.html | 2026-08-10 02:09 | 45K | |
![[TXT]](/icons/text.gif) | dampak-kemunculan-virus-covid-subvarian-delta-plus.html | 2026-08-10 02:09 | 114K | |
![[TXT]](/icons/text.gif) | cholelithiasis.html | 2026-08-10 02:09 | 106K | |
![[TXT]](/icons/text.gif) | badai-sitokin-pada-penderita-covid.html | 2026-08-10 02:09 | 110K | |
![[DIR]](/icons/folder.gif) | Uptime Institute. (2023). Tier Standard_ Topology. https_/ | 2026-08-10 02:09 | - | |
![[TXT]](/icons/text.gif) | Pemerintah Republik Indonesia. UU No. 8 Tahun 1999 tentang Undang-Undang Perlindungan Konsumen. LN No. 22 Tahun 1999, TLN No. 3821.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | tax-planning-pph-badan-vs-creative-accounting.html | 2026-08-10 02:09 | 46K | |
![[TXT]](/icons/text.gif) | risiko-ledakan-debu-dust-explosion.html | 2026-08-10 02:09 | 46K | |
![[TXT]](/icons/text.gif) | penyebab-bau-badan.html | 2026-08-10 02:09 | 113K | |
![[TXT]](/icons/text.gif) | pembangkit-listrik-tenaga-panas-bumi-pltp.html | 2026-08-10 02:09 | 53K | |
![[TXT]](/icons/text.gif) | nutrisi-untuk-rambut.html | 2026-08-10 02:09 | 148K | |
![[TXT]](/icons/text.gif) | ngeri-ngeri-sedap-4-belajar-dari-emak-emak.html | 2026-08-10 02:09 | 42K | |
![[TXT]](/icons/text.gif) | kepailitan-perusahaan-asuransi.html | 2026-08-10 02:09 | 54K | |
![[TXT]](/icons/text.gif) | dampak-penerapan-peraturan-ojk-tentang-tarif-baru-terhadap-industri-asuransi-harta-benda.html | 2026-08-10 02:09 | 51K | |
![[TXT]](/icons/text.gif) | asuransi-barang-milik-negara.html | 2026-08-10 02:09 | 59K | |
![[TXT]](/icons/text.gif) | apa-sih-kebijakan-moneter-kebijakan-fiskal.html | 2026-08-10 02:09 | 50K | |
![[TXT]](/icons/text.gif) | Peraturan Pemerintah Nomor 37 Tahun 1998 tentang Peraturan Jabatan Pejabat Pembuat Akta Tanah.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | 1.Badan Penanggulangan Bencana Daerah Pemerintah Kabupaten Bogor. Bpbd.bogorkab.go.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | rubeola.html | 2026-08-10 02:09 | 105K | |
![[TXT]](/icons/text.gif) | mengenal-varian-trgor.html | 2026-08-10 02:09 | 106K | |
![[TXT]](/icons/text.gif) | mengapa-reasuransi-ada-di-dunia.html | 2026-08-10 02:09 | 45K | |
![[TXT]](/icons/text.gif) | genetic-testing.html | 2026-08-10 02:09 | 68K | |
![[TXT]](/icons/text.gif) | extrapulmonary-tuberculosis.html | 2026-08-10 02:09 | 111K | |
![[TXT]](/icons/text.gif) | bisnis-hulu-migas-pendahuluan-tata-kelola-migas.html | 2026-08-10 02:09 | 50K | |
![[TXT]](/icons/text.gif) | amunisi-pandemi-anak-bangsa.html | 2026-08-10 02:09 | 115K | |
![[TXT]](/icons/text.gif) | Undang Undang No.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Undang-Undang Nomor 7 Tahun 2011 tentang Mata Uang.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | The Economics of Reinsurance, George Blazenko, Published By_ American Risk and Insurance Association.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Sidhu, B.S. 2023. Likely Impacts of the 2022 heatwave on India’s wheat production. Environmental Research Letters, 18.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Schneider Electric. (2021). White Paper_ Data Center Physical Infrastructure Design.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | R. Subekti dan R. Tjitrosudibio. 1992. Kitab Undang-Undang Hukum Perdata, Terjemahan Jakarta_ PT. Pradnya Paramita.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | MSCI Inc. (2026, January 27). Announcement on free float assessment and interim treatment for Indonesian securities. MSCI Global Standard Indexes.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Horgby, P. (1998). Risk Classification by Fuzzy Inference. The Geneva Papers on Risk and Insurance Theory, 23_ 63-82.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | syphilis.html | 2026-08-10 02:09 | 60K | |
![[TXT]](/icons/text.gif) | risiko-dan-penyebab-fenomena-bleve-boiling-liquid-expanding-vapor-explosion.html | 2026-08-10 02:09 | 47K | |
![[TXT]](/icons/text.gif) | pilihan-menabung-investasi-beresiko-rendah-untuk-generasi-milenial.html | 2026-08-10 02:09 | 65K | |
![[TXT]](/icons/text.gif) | peranan-varian-mutasi-dalam-lonjakan-kasus-covid-19-di-indonesia.html | 2026-08-10 02:09 | 111K | |
![[TXT]](/icons/text.gif) | peran-asuransi-dalam-menjaga-kepercayaan-konsumen-tanggung-jawab-produsen-dalam-setiap-produk-2.html | 2026-08-10 02:09 | 46K | |
![[TXT]](/icons/text.gif) | pengaruh-dan-risiko-dinamika-pasar-komoditas-terhadap-asuransi-pengangkutan-barang.html | 2026-08-10 02:09 | 42K | |
![[TXT]](/icons/text.gif) | jenis-penahanan-berdasarkan-hukum-acara-pidana.html | 2026-08-10 02:09 | 53K | |
![[TXT]](/icons/text.gif) | jenis-dan-sanksi-pelanggaran-lalu-lintas.html | 2026-08-10 02:09 | 58K | |
![[TXT]](/icons/text.gif) | fenomena-penyimpangan-suhu-dan-dampaknya-di-indonesia.html | 2026-08-10 02:09 | 49K | |
![[TXT]](/icons/text.gif) | alcohol-related-liver-disease.html | 2026-08-10 02:09 | 108K | |
![[TXT]](/icons/text.gif) | Peraturan Pemerintah No.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | El Kharraz, J. 2012. Water Scarcity and Drought in WANA Countries. Procedia Engineerng, 33_ 14-29.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Christopherson, DA, et al. 2020. High-Efficiency Particulate Air Filters in the Era of COVID-19_ Function and Efficacy, Sage Journals_ Volume 163 pg. 1153-1155.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | vaksin-untuk-anak-iya-atau-tidak.html | 2026-08-10 02:09 | 109K | |
![[TXT]](/icons/text.gif) | serba-serbi-keluarga-berencana.html | 2026-08-10 02:09 | 123K | |
![[TXT]](/icons/text.gif) | ngeri-ngeri-sedap-2-akumulasi-senyap-ko-asuransi--facultative-inward.html | 2026-08-10 02:09 | 42K | |
![[TXT]](/icons/text.gif) | mengenal-scam-email-melalui-kasus-sederhana.html | 2026-08-10 02:09 | 45K | |
![[TXT]](/icons/text.gif) | klasifikasi-jenis-kebakaran-berdasarkan-nfpa.html | 2026-08-10 02:09 | 45K | |
![[TXT]](/icons/text.gif) | hey-daging-merah-seberapa-bahayakah-kamu.html | 2026-08-10 02:09 | 62K | |
![[TXT]](/icons/text.gif) | fenomena-resistensi-antibiotik-dan-infeksi-superbug.html | 2026-08-10 02:09 | 118K | |
![[TXT]](/icons/text.gif) | apakah-menguap-itu-selalu-pertanda-mengantuk.html | 2026-08-10 02:09 | 107K | |
![[TXT]](/icons/text.gif) | U.S. Department of Energy. 2019. The Ultimate Fast Facts Guide to Nuclear Energy. United States.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Populasi Malaysia Menua Lebih Cepat dari Perkiraan, Apa Dampaknya20bc.html | 2026-08-10 02:09 | 4.4K | |
![[DIR]](/icons/folder.gif) | Halodoc. (2025). Olahraga yang Sangat Intens Dapat Sebabkan Rhabdomyolysis. https_/ | 2026-08-10 02:09 | - | |
![[TXT]](/icons/text.gif) | underweight-dan-bahaya-kesehatan-di-baliknya.html | 2026-08-10 02:09 | 112K | |
![[TXT]](/icons/text.gif) | serangan-jantung-di-usia-muda.html | 2026-08-10 02:09 | 61K | |
![[TXT]](/icons/text.gif) | pandemi-covid-19-katalis-intelligent-learning.html | 2026-08-10 02:09 | 43K | |
![[TXT]](/icons/text.gif) | mengenal-lebih-jauh-peran-bank-sampah.html | 2026-08-10 02:09 | 50K | |
![[TXT]](/icons/text.gif) | mau-investasi-saham-yuk-lihat-dulu-contoh-performa-beberapa-saham-ini.html | 2026-08-10 02:09 | 51K | |
![[TXT]](/icons/text.gif) | jenis-jenis-kepemilikan-hak-atas-tanah.html | 2026-08-10 02:09 | 57K | |
![[TXT]](/icons/text.gif) | inverted-yield-curve-akankah-kita-memasuki-resesi-ekonomi.html | 2026-08-10 02:09 | 45K | |
![[TXT]](/icons/text.gif) | bulimia-nervosa.html | 2026-08-10 02:09 | 58K | |
![[TXT]](/icons/text.gif) | beragam-manfaat-dari-si-ungu-bunga-telang.html | 2026-08-10 02:09 | 42K | |
![[TXT]](/icons/text.gif) | apa-itu-resesi.html | 2026-08-10 02:09 | 51K | |
![[TXT]](/icons/text.gif) | Fahamsyah, E., Hariyani, I., & Rimba, A. (2020). Regulating Pet Insurance in Indonesia. Lentera Hukum, 7, 55.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | 34ths-collision-liability-clause.html | 2026-08-10 02:09 | 42K | |
![[TXT]](/icons/text.gif) | pre-eclampsia.html | 2026-08-10 02:09 | 59K | |
![[TXT]](/icons/text.gif) | perbedaan-tindak-pidana-ringan-dengan-pelanggaran-dalam-sistem-hukum-pidana.html | 2026-08-10 02:09 | 68K | |
![[TXT]](/icons/text.gif) | menangani-gigitan-ular.html | 2026-08-10 02:09 | 115K | |
![[TXT]](/icons/text.gif) | manfaat-bawang-putih.html | 2026-08-10 02:09 | 111K | |
![[TXT]](/icons/text.gif) | kebijakan-ekonomi-di-beberapa-negara-asia-terkait-covid-19.html | 2026-08-10 02:09 | 60K | |
![[TXT]](/icons/text.gif) | gagal-ginjal-akut.html | 2026-08-10 02:09 | 65K | |
![[TXT]](/icons/text.gif) | fungsi-knowledge-management-untuk-menciptakan-inovasi-di-organisasi-melalui-tacit-knowledge-capturing-and-sharing.html | 2026-08-10 02:09 | 44K | |
![[TXT]](/icons/text.gif) | evidence-based-medicine.html | 2026-08-10 02:09 | 111K | |
![[TXT]](/icons/text.gif) | Virus Hanta Muncul di Bandung, Bahaya atau Bisa Sembuh7529.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | GmbH, R. B. 2020. Bosch Automotive Handbook, 9th Edition.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | vaksin-moderna-di-indonesia.html | 2026-08-10 02:09 | 111K | |
![[TXT]](/icons/text.gif) | pembebanan-hak-tanggungan-dalam-pemberian-kredit.html | 2026-08-10 02:09 | 44K | |
![[TXT]](/icons/text.gif) | mengenal-istilah-contempt-of-court.html | 2026-08-10 02:09 | 59K | |
![[TXT]](/icons/text.gif) | mengenal-herd-immunity.html | 2026-08-10 02:09 | 114K | |
![[TXT]](/icons/text.gif) | mengapa-garam-dapat-menyebabkan-tekanan-darah-meningkat.html | 2026-08-10 02:09 | 108K | |
![[TXT]](/icons/text.gif) | kesiapan-edar-vaksin-sinovac-di-indonesia.html | 2026-08-10 02:09 | 125K | |
![[TXT]](/icons/text.gif) | ada-apa-dengan-china.html | 2026-08-10 02:09 | 117K | |
![[DIR]](/icons/folder.gif) | McKinsey & Company. (2021). Digital Trust_ The Foundation for Data-led Transformation in Insurance. Retrieved from https_/ | 2026-08-10 02:09 | - | |
![[TXT]](/icons/text.gif) | Bisco, J. M., & Fier, S. G. (2020). Licensing and Reporting in the US Pet Insurance Market. Journal of Insurance Regulation, 39(2).html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | What Is Hole in One Insurance and How Does It Worke2cf.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | waspadai-serangan-usus-buntu-yang-sering-datang-tiba-tiba.html | 2026-08-10 02:09 | 46K | |
![[TXT]](/icons/text.gif) | premium-payment-warranty-pada-kontrak-perjanjian-reasuransi-jiwa.html | 2026-08-10 02:09 | 49K | |
![[TXT]](/icons/text.gif) | mewaspadai-potensi-penyakit-ginjal-pada-penyintas-covid.html | 2026-08-10 02:09 | 109K | |
![[TXT]](/icons/text.gif) | mengenal-diabetes-mellitus-type-5-1.html | 2026-08-10 02:09 | 111K | |
![[TXT]](/icons/text.gif) | manfaat-manajemen-aset-asset-management-bagi-perusahaan.html | 2026-08-10 02:09 | 48K | |
![[TXT]](/icons/text.gif) | kewajiban-pengguna-materai-tempel-rp-10000.html | 2026-08-10 02:09 | 55K | |
![[TXT]](/icons/text.gif) | keterkaitan-asma-dengan-gerd.html | 2026-08-10 02:09 | 109K | |
![[TXT]](/icons/text.gif) | hak-konsumen-yang-membeli-barang-dengan-cacat-tersembunyi.html | 2026-08-10 02:09 | 61K | |
![[TXT]](/icons/text.gif) | gangguan-cemas.html | 2026-08-10 02:09 | 62K | |
![[TXT]](/icons/text.gif) | Touran, Nick. 2024b53a.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Don Donohue and Goerge Thomas.Construction Surety Bonds in Plain English. 1996.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | serba-serbi-warna-ingus.html | 2026-08-10 02:09 | 107K | |
![[TXT]](/icons/text.gif) | prostatitis.html | 2026-08-10 02:09 | 105K | |
![[TXT]](/icons/text.gif) | pertumbuhan-perekonomian-dunia-2017.html | 2026-08-10 02:09 | 39K | |
![[TXT]](/icons/text.gif) | pentingnya-mengetahui-fictie-hukum.html | 2026-08-10 02:09 | 58K | |
![[TXT]](/icons/text.gif) | mengenal-istilah-hukum-zaakwarneming.html | 2026-08-10 02:09 | 56K | |
![[TXT]](/icons/text.gif) | memahami-isi-fungsi-dan-tantangan-interpretasi-business-interruption-insurance.html | 2026-08-10 02:09 | 47K | |
![[TXT]](/icons/text.gif) | depresi.html | 2026-08-10 02:09 | 64K | |
![[TXT]](/icons/text.gif) | bangga-rupiah-simbol-kedaulatan-alat-pembayaran-sah-dan-pemersatu-bangsa.html | 2026-08-10 02:09 | 47K | |
![[TXT]](/icons/text.gif) | ada-apa-dengan-ba4-dan-ba5.html | 2026-08-10 02:09 | 111K | |
![[DIR]](/icons/folder.gif) | MSD Manuals. (2025). Rabdomiolisis — Gangguan Ginjal dan Saluran Kemih. https_/ | 2026-08-10 02:09 | - | |
![[TXT]](/icons/text.gif) | psak-13-properti-investasi.html | 2026-08-10 02:09 | 54K | |
![[TXT]](/icons/text.gif) | menggunakan-aset-orang-lain-untuk-menjamin-hutang.html | 2026-08-10 02:09 | 44K | |
![[TXT]](/icons/text.gif) | mengenal-produk-derivatives-options-dan-futures.html | 2026-08-10 02:09 | 58K | |
![[TXT]](/icons/text.gif) | menakar-risiko-data-center-melalui-sistem-tier.html | 2026-08-10 02:09 | 49K | |
![[TXT]](/icons/text.gif) | infeksi-hpv-kanker-cervix-dan-metode-pencegahannya.html | 2026-08-10 02:09 | 112K | |
![[TXT]](/icons/text.gif) | imunisasi-rotavirus.html | 2026-08-10 02:09 | 106K | |
![[TXT]](/icons/text.gif) | disiplin-dalam-bisnis-asuransi-apakah-kita-sudah-melakukannya.html | 2026-08-10 02:09 | 50K | |
![[TXT]](/icons/text.gif) | digital-subtraction-angiography.html | 2026-08-10 02:09 | 65K | |
![[TXT]](/icons/text.gif) | bahaya-strobo-bagi-kesehatan.html | 2026-08-10 02:09 | 112K | |
![[TXT]](/icons/text.gif) | Kementerian Lingkungan Hidup dan Kehutanan, 2021. Updated Nationally Determined Contribution Republic of Indonesia. s.l._s.n.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | J.G. Starke, Pengantar Hukum Internasional 2 Edisi Kesepuluh, Sinar Grafika, Jakarta, 1989.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Budiasih, K. S. 2017. Kajian Potensi Farmakologis Bunga Telang (Clitoria ternatea).html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | pengaruh-el-nino-southern-osciliation-terhadap-perubahan-cuaca-dan-musim.html | 2026-08-10 02:09 | 50K | |
![[TXT]](/icons/text.gif) | mengenal-vaksin-pfizer.html | 2026-08-10 02:09 | 109K | |
![[TXT]](/icons/text.gif) | mengenal-standard-iso-310002018.html | 2026-08-10 02:09 | 41K | |
![[TXT]](/icons/text.gif) | mengenal-cresta-zone-dalam-industri-perasuransian.html | 2026-08-10 02:09 | 43K | |
![[TXT]](/icons/text.gif) | lonjakan-kasus-pertussis-di-singapore-akankan-menjadi-wabah-baru-di-indonesia.html | 2026-08-10 02:09 | 111K | |
![[TXT]](/icons/text.gif) | knock-nevis-long-journey-from-japan-to-alang-india.html | 2026-08-10 02:09 | 61K | |
![[TXT]](/icons/text.gif) | kembali-ingatkan-tips-menyelamatkan-diri-saat-gempa.html | 2026-08-10 02:09 | 43K | |
![[TXT]](/icons/text.gif) | bongkar-fakta-klorokuin-dalam-perang-melawan-covid.html | 2026-08-10 02:09 | 110K | |
![[TXT]](/icons/text.gif) | Undang-Undang Republik Indonesia Nomor 40 Tahun 2014 tentang Perasuransian.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Spence, R., Gunesekara, R. and Zuccaro, G., 2009. Insurance risks from volcanic eruptions in Europe. WRN Research Bulletin, Willis Research Network.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Pulserimia, A. (2022). SOCIAL SECURITY PROCEDURES FOR WORKERS POST WORK ACCIDENT. Khairun Law Journal, 6(1), 1-10.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | North American Pet Health Insurance Association. (2024). 2024 State of the Industry Report. GoCompare. (n.d.)c1b9.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Kitab Undang-undang Hukum Perdata.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | serba-serbi-vitamin-d.html | 2026-08-10 02:09 | 116K | |
![[TXT]](/icons/text.gif) | rokok-elektronik-penolong-dari-ketergantungan-atau-alternatif-baru-merokok.html | 2026-08-10 02:09 | 112K | |
![[TXT]](/icons/text.gif) | polycystic-kidney-disease.html | 2026-08-10 02:09 | 58K | |
![[TXT]](/icons/text.gif) | penyakit-tipes-penyakit-masyarakat-indonesia.html | 2026-08-10 02:09 | 108K | |
![[TXT]](/icons/text.gif) | mekanisme-pembangkitan-listrik-pada-generator.html | 2026-08-10 02:09 | 49K | |
![[TXT]](/icons/text.gif) | manfaat-berpuasa-bagi-kesehatan.html | 2026-08-10 02:09 | 109K | |
![[TXT]](/icons/text.gif) | gangguan-pencernaan-pada-kasus-covid-19.html | 2026-08-10 02:09 | 110K | |
![[TXT]](/icons/text.gif) | bedah-kosmetik-payudara.html | 2026-08-10 02:09 | 63K | |
![[TXT]](/icons/text.gif) | Undang-Undang Nomor 18 Tahun 2008 tentang Pengelolaan Sampah.html | 2026-08-10 02:09 | 4.4K | |
![[DIR]](/icons/folder.gif) | Churchill, J., & Ward, E. (2016). Communicating/ | 2026-08-10 02:09 | - | |
![[TXT]](/icons/text.gif) | trend-asuransi-machinery-breakdown-di-indonesia.html | 2026-08-10 02:09 | 39K | |
![[TXT]](/icons/text.gif) | transplantasi-liver.html | 2026-08-10 02:09 | 107K | |
![[TXT]](/icons/text.gif) | tentang-varian-omicron-.html | 2026-08-10 02:09 | 110K | |
![[TXT]](/icons/text.gif) | sudah-amankah-wfh-kita.html | 2026-08-10 02:09 | 46K | |
![[TXT]](/icons/text.gif) | psak-117--definisi-kontrak-asuransi.html | 2026-08-10 02:09 | 40K | |
![[TXT]](/icons/text.gif) | polemik-vaksin-astrazeneca.html | 2026-08-10 02:09 | 112K | |
![[TXT]](/icons/text.gif) | pengaruh-interaksi-atmosfer-sekitar-indonesia.html | 2026-08-10 02:09 | 44K | |
![[TXT]](/icons/text.gif) | pembangkit-listrik-tenaga-uap-pltu.html | 2026-08-10 02:09 | 53K | |
![[TXT]](/icons/text.gif) | intervensi-pihak-ketiga-dalam-pemeriksaan-perkara-perdata.html | 2026-08-10 02:09 | 56K | |
![[TXT]](/icons/text.gif) | frequently-ignored-the-use-of-bahasa-in-reinsurance-contract-is-essential.html | 2026-08-10 02:09 | 44K | |
![[TXT]](/icons/text.gif) | energi-dalam-kaidah-ilmu-termodinamika.html | 2026-08-10 02:09 | 59K | |
![[TXT]](/icons/text.gif) | Badan Pengkajian dan Penerapan Teknologi. (2018). Outlook Energi Indonesia 2018. Jakarta.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | waspada-demam-berdarah-dengue-dbd.html | 2026-08-10 02:09 | 121K | |
![[TXT]](/icons/text.gif) | refleksi-renewal-2012-dan-menatap-renewal-2013.html | 2026-08-10 02:09 | 44K | |
![[TXT]](/icons/text.gif) | penerapan-navigation-limit-polis-hm-dalam-konteks-perils-of-the-sea-dan-kondisi-perairan-indonesia.html | 2026-08-10 02:09 | 55K | |
![[TXT]](/icons/text.gif) | part-i-automatic-termination-pembatalan-polis-otomatis-pada-asuransi-rangka-kapal-marine-hull.html | 2026-08-10 02:09 | 42K | |
![[TXT]](/icons/text.gif) | ngeri-ngeri-sedap-1-konsentrasi-akumulasi-katastropik.html | 2026-08-10 02:09 | 41K | |
![[TXT]](/icons/text.gif) | mitigasi-dan-adaptasi-indonesia-dalam-pencegahan-perubahan-iklim.html | 2026-08-10 02:09 | 56K | |
![[TXT]](/icons/text.gif) | infeksi-hpv.html | 2026-08-10 02:09 | 59K | |
![[TXT]](/icons/text.gif) | excess-of-loss-pricing-hal-yang-sering-terabaikan.html | 2026-08-10 02:09 | 40K | |
![[TXT]](/icons/text.gif) | anorexia-nervosa.html | 2026-08-10 02:09 | 58K | |
![[TXT]](/icons/text.gif) | Zurich Insurance. (2020). Data Center Risk Engineering Guidelines.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Undang-Undang No. 2 Tahun 2014 tentang Perubahan atas Undang-Undang No.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Munir, Bahder 2018.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Indonesia Law Number 42 of 1999 on Fiduciary.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | studi-kasus-klaim-pada-jenis-pertanggungan-personal-accident.html | 2026-08-10 02:09 | 43K | |
![[TXT]](/icons/text.gif) | proses-pembuatan-semen-dan-risiko-pada-pabrik-semen.html | 2026-08-10 02:09 | 47K | |
![[TXT]](/icons/text.gif) | professional-indemnity-insurance.html | 2026-08-10 02:09 | 46K | |
![[TXT]](/icons/text.gif) | polemik-ivermectin-dalam-pengobatan-covid-19.html | 2026-08-10 02:09 | 113K | |
![[TXT]](/icons/text.gif) | hepatitis-a.html | 2026-08-10 02:09 | 58K | |
![[TXT]](/icons/text.gif) | hak-penumpang-jika-pesawat-delay.html | 2026-08-10 02:09 | 58K | |
![[TXT]](/icons/text.gif) | gempa-cianjur-dan-garut-serupa-tapi-tak-sama.html | 2026-08-10 02:09 | 46K | |
![[TXT]](/icons/text.gif) | chikungunya.html | 2026-08-10 02:09 | 105K | |
![[TXT]](/icons/text.gif) | asuransi-pencemaran-lingkungan.html | 2026-08-10 02:09 | 41K | |
![[TXT]](/icons/text.gif) | alokasi-aset-investasi-di-industri-asuransi-indonesia.html | 2026-08-10 02:09 | 49K | |
![[TXT]](/icons/text.gif) | -Wirjono Prodjodikoro. 2003. Asas-Asas Hukum Pidana di Indonesia. Bandung_ Refika Aditama.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | vegan-vs-vegetarian.html | 2026-08-10 02:09 | 114K | |
![[TXT]](/icons/text.gif) | riset-pemerintah-untuk-asuransi-kesehatan-di-indonesia.html | 2026-08-10 02:09 | 46K | |
![[TXT]](/icons/text.gif) | meningitis.html | 2026-08-10 02:09 | 105K | |
![[TXT]](/icons/text.gif) | mengenal-pembangkit-listrik-tenaga-air-plta.html | 2026-08-10 02:09 | 46K | |
![[TXT]](/icons/text.gif) | mengenal-batuk-berdarah.html | 2026-08-10 02:09 | 109K | |
![[TXT]](/icons/text.gif) | chronic-fatigue-syndrome.html | 2026-08-10 02:09 | 108K | |
![[TXT]](/icons/text.gif) | Organisation for Economic Co-operation and Development. (2022). Market integrity, transparency, and investor confidence. OECD Publishing.html | 2026-08-10 02:09 | 4.4K | |
![[DIR]](/icons/folder.gif) | EY. (2023). Global Insurance Outlook_ Building Cyber Resilience and Strengthening Data Governance. Retrieved from https_/ | 2026-08-10 02:09 | - | |
![[TXT]](/icons/text.gif) | -risiko-transmisi-covid-19-dalam-penerbangan.html | 2026-08-10 02:09 | 107K | |
![[TXT]](/icons/text.gif) | respon-treaty-terhadap-aftershock--mainshock-pada-gempa-majene.html | 2026-08-10 02:09 | 43K | |
![[TXT]](/icons/text.gif) | pengenalan-sistem-transmisi-dan-distribusi-listrik.html | 2026-08-10 02:09 | 48K | |
![[TXT]](/icons/text.gif) | mengenal-rambut.html | 2026-08-10 02:09 | 111K | |
![[TXT]](/icons/text.gif) | kenalan-dengan-cyber-risk-yuk.html | 2026-08-10 02:09 | 44K | |
![[TXT]](/icons/text.gif) | kanker-lambung.html | 2026-08-10 02:09 | 109K | |
![[TXT]](/icons/text.gif) | covid-19-dan-demam-dengue.html | 2026-08-10 02:09 | 109K | |
![[TXT]](/icons/text.gif) | business-process-transformation-bpt--tren-terbaru-dalam-business-process-improvement-bpi.html | 2026-08-10 02:09 | 48K | |
![[DIR]](/icons/folder.gif) | Otoritas Jasa Keuangan (2025). POJK Nomor 36 Tahun 2025 tentang Penyelenggaraan Produk Asuransi Kesehatan. Retrieved from https_/ | 2026-08-10 02:09 | - | |
![[TXT]](/icons/text.gif) | Kementerian Kesehatan RI. (2013). Riset Kesehatan Dasar 2013.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Bursa Efek Indonesia. (2024). Peraturan pencatatan saham dan ketentuan free float. PT Bursa Efek Indonesia.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | wacana-dimulainya-penyelenggaraan-sekolah-tatap-muka-kembali.html | 2026-08-10 02:09 | 113K | |
![[TXT]](/icons/text.gif) | virus-nipah-ancaman-penyakit-emerging-yang-harus-diwaspadai-dan-pentingnya-perlindungan-asuransi-kesehatan.html | 2026-08-10 02:09 | 110K | |
![[TXT]](/icons/text.gif) | tujuan-pembangunan-berkelanjutan--sustainable-development-goals.html | 2026-08-10 02:09 | 46K | |
![[TXT]](/icons/text.gif) | mengapa-kita-mengalami-cegukan.html | 2026-08-10 02:09 | 114K | |
![[TXT]](/icons/text.gif) | fatty-liver.html | 2026-08-10 02:09 | 63K | |
![[TXT]](/icons/text.gif) | extension-cover-unscheduled-chartered-flight-di-indonesia.html | 2026-08-10 02:09 | 46K | |
![[TXT]](/icons/text.gif) | dari-sahabat-menjadi-keluarga-apakah-hewan-peliharaan-butuh-asuransi.html | 2026-08-10 02:09 | 50K | |
![[TXT]](/icons/text.gif) | creating-shared-value-csv.html | 2026-08-10 02:09 | 42K | |
![[TXT]](/icons/text.gif) | acoustic-positioning-for-oil-and-gas-industry.html | 2026-08-10 02:09 | 60K | |
![[TXT]](/icons/text.gif) | UU No.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | International Energy Agency. (2023). The future of hydrogen_ Seizing today’s opportunities. IEA Publications.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | social-drinker.html | 2026-08-10 02:09 | 119K | |
![[TXT]](/icons/text.gif) | sifilis.html | 2026-08-10 02:09 | 107K | |
![[TXT]](/icons/text.gif) | penyakit-gout-mortalitas-bukan-sekedar-morbiditas.html | 2026-08-10 02:09 | 60K | |
![[TXT]](/icons/text.gif) | excess-of-loss-top-drop-cover-dan-drop-down-cover.html | 2026-08-10 02:09 | 41K | |
![[TXT]](/icons/text.gif) | diet-sehat-itu-seperti-apa.html | 2026-08-10 02:09 | 114K | |
![[TXT]](/icons/text.gif) | covid-centaurus.html | 2026-08-10 02:09 | 113K | |
![[TXT]](/icons/text.gif) | Boer, Rizaldi. 2005. Agricultular Drought in Indonesia. Monitoring and Predictting Agricultural Drought_ A Global Study.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | -dominasi-klaster-perkantoran-pada-pandemi-covid-19.html | 2026-08-10 02:09 | 112K | |
![[TXT]](/icons/text.gif) | penyerahan-pelaku-tindak-pidana-melalui-ekstradisi-.html | 2026-08-10 02:09 | 54K | |
![[TXT]](/icons/text.gif) | peningkatan-insidensi-kanker-di-usia-muda.html | 2026-08-10 02:09 | 46K | |
![[TXT]](/icons/text.gif) | mengenal-nyeri-dada.html | 2026-08-10 02:09 | 111K | |
![[TXT]](/icons/text.gif) | membangun-budaya-risiko.html | 2026-08-10 02:09 | 42K | |
![[TXT]](/icons/text.gif) | kebangkitan-infeksi-polio-di-indonesia.html | 2026-08-10 02:09 | 116K | |
![[TXT]](/icons/text.gif) | jaminan-sosial-ketenagakerjaan-implementasi-manfaat-dan-tanggung-jawab-perusahaan-terhadap-keselamatan-kerja-1.html | 2026-08-10 02:09 | 44K | |
![[TXT]](/icons/text.gif) | bookkeeper-to-advisory-service.html | 2026-08-10 02:09 | 46K | |
![[TXT]](/icons/text.gif) | bencana-banjir-apakah-kerugiannya-hanya-berdampak-pada-asuransi-umum-saja.html | 2026-08-10 02:09 | 112K | |
![[TXT]](/icons/text.gif) | agile-organizations-for-finance-unit.html | 2026-08-10 02:09 | 44K | |
![[TXT]](/icons/text.gif) | Shleifer, A., & Vishny, R. W. (1997). A survey of corporate governance. The Journal of Finance, 52(2), 737--783.html | 2026-08-10 02:09 | 4.4K | |
![[DIR]](/icons/folder.gif) | Martens, P., Hansart, C., and Su, B. (2019). At/ | 2026-08-10 02:09 | - | |
![[TXT]](/icons/text.gif) | IAEA. 2012. Fusion Physics.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | what-is-asset-class-mengenal-beberapa-kelas-aset-investasi-di-indonesia.html | 2026-08-10 02:09 | 53K | |
![[TXT]](/icons/text.gif) | ramsay-hunt-syndrome.html | 2026-08-10 02:09 | 107K | |
![[TXT]](/icons/text.gif) | peningkatan-modal-disetor-minimum-perusahaan-perasuransian-kesiapan-industri--pentingnya-permodalan.html | 2026-08-10 02:09 | 57K | |
![[TXT]](/icons/text.gif) | penerapan-psak-65-serta-relevansi-psak-15-dan-psak-22.html | 2026-08-10 02:09 | 48K | |
![[TXT]](/icons/text.gif) | mengenali-contoh-contoh-kerusakan-fisik-pada-turbin-angin.html | 2026-08-10 02:09 | 50K | |
![[TXT]](/icons/text.gif) | memahami-perubahan-aturan-bpjs-kesehatan-serta-pengaruhnya--terhadap-industri-perasuransian-nasional.html | 2026-08-10 02:09 | 112K | |
![[TXT]](/icons/text.gif) | kolesterol-yang-terlalu-rendah.html | 2026-08-10 02:09 | 106K | |
![[TXT]](/icons/text.gif) | hukum-waris-di-indonesia.html | 2026-08-10 02:09 | 66K | |
![[TXT]](/icons/text.gif) | hfmd.html | 2026-08-10 02:09 | 106K | |
![[TXT]](/icons/text.gif) | ultimum-remedium-dan-primum-remedium-dalam-sistem-hukum-pidana-indonesia.html | 2026-08-10 02:09 | 61K | |
![[TXT]](/icons/text.gif) | surety-bond-insurance-perjanjian-accesoir-dalam-konteks-jaminan-keuangan.html | 2026-08-10 02:09 | 43K | |
![[TXT]](/icons/text.gif) | risiko-myokarditis-pada-penerima-vaksin-mrna.html | 2026-08-10 02:09 | 114K | |
![[TXT]](/icons/text.gif) | pengajuan-asuransi-jiwa-dan-kesehatan-bagi-penyintas-covid.html | 2026-08-10 02:09 | 111K | |
![[TXT]](/icons/text.gif) | pabrik-corrugated-paper-dan-risikonya.html | 2026-08-10 02:09 | 43K | |
![[TXT]](/icons/text.gif) | kiat-cerdik-lindungi-bisnis-dari-aksi-kriminal-1.html | 2026-08-10 02:09 | 60K | |
![[TXT]](/icons/text.gif) | egfr.html | 2026-08-10 02:09 | 68K | |
![[TXT]](/icons/text.gif) | diet-and-highlight-hidup-sehat-dengan-probiotik.html | 2026-08-10 02:09 | 60K | |
![[TXT]](/icons/text.gif) | dictionary.com, 2021. Cyclone vs. Typhoon vs. Hurricane vsd4f7.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Ery, J. (2024). Actuarial Data Science_ Insights from Pricing, Capital Modeling and CAT Bonds (Doctoral dissertation, ETH Zurich).html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | pentingnya-clinical-trial-insurance-bagi-dunia-kesehatan.html | 2026-08-10 02:09 | 45K | |
![[TXT]](/icons/text.gif) | multisystem-inflammatory-syndrome-in-children-mis-c.html | 2026-08-10 02:09 | 108K | |
![[TXT]](/icons/text.gif) | menghindari-pelanggaran-hak-cipta.html | 2026-08-10 02:09 | 75K | |
![[TXT]](/icons/text.gif) | melatih-intuisi-menilai-harga-kapal.html | 2026-08-10 02:09 | 42K | |
![[TXT]](/icons/text.gif) | manfaat-zat-besi-untuk-tubuh.html | 2026-08-10 02:09 | 109K | |
![[TXT]](/icons/text.gif) | institute-cyber-attack-exclusion-clause-cl380.html | 2026-08-10 02:09 | 42K | |
![[TXT]](/icons/text.gif) | dampak-penerapan-psak-24-pada-laporan-keuangan-perusahaan-tahun-2015.html | 2026-08-10 02:09 | 47K | |
![[TXT]](/icons/text.gif) | cystitis.html | 2026-08-10 02:09 | 107K | |
![[TXT]](/icons/text.gif) | bumn-kembali-memungut-menyetor-dan-melaporkan-ppn-ppnbm.html | 2026-08-10 02:09 | 46K | |
![[TXT]](/icons/text.gif) | Putri, D. N., & Lestari, F. (2023). Literature Review_ Analisis Penyebab Kecelakaan Kerja Pada Pekerja Di Proyek Konstruksi. Journals of Ners Community, 13(1), 170-184.html | 2026-08-10 02:09 | 4.4K | |
![[DIR]](/icons/folder.gif) | Mount Elizabeth Hospital. (2021). Rhabdomyolysis_ Exercise, Spin & CrossFit. https_/ | 2026-08-10 02:09 | - | |
![[TXT]](/icons/text.gif) | tiga-tipe-sikap-dalam-persepsi-risiko-asuransi.html | 2026-08-10 02:09 | 42K | |
![[TXT]](/icons/text.gif) | semaraknya-kasus-obesitas-pada-anak.html | 2026-08-10 02:09 | 65K | |
![[TXT]](/icons/text.gif) | protein-dan-asam-amino.html | 2026-08-10 02:09 | 106K | |
![[TXT]](/icons/text.gif) | pengaruh-penggunaan-proton-pump-inhibitor-terhadap-gangguan-kandung-empedu.html | 2026-08-10 02:09 | 110K | |
![[TXT]](/icons/text.gif) | infeksi-jamur-hitam-pada-penderita-covid-19.html | 2026-08-10 02:09 | 110K | |
![[TXT]](/icons/text.gif) | claims-official-vs-independent-loss-adjuster-the-missing-word.html | 2026-08-10 02:09 | 41K | |
![[TXT]](/icons/text.gif) | banjir-penyakit-pes-dan-leptospirosis.html | 2026-08-10 02:09 | 118K | |
![[DIR]](/icons/folder.gif) | World Gold Council. (2023). Gold Demand Trends 2023. WGC. https_/ | 2026-08-10 02:09 | - | |
![[TXT]](/icons/text.gif) | Vallero, Daniel. 2008. Fundamental of Air Pollution. London_ Elsevier.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Peraturan Menteri Lingkungan Hidup dan Kehutanan No.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Dalkir, Kimiz. (2005). Knowledge management in Theory and Practice. United State of America. Elsevier Inc.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | tanggung-jawab-pengelola-atas-kendaraan-yang-hilang-di-tempat-parkir.html | 2026-08-10 02:09 | 56K | |
![[TXT]](/icons/text.gif) | mengenal-standard-iso-27001.html | 2026-08-10 02:09 | 45K | |
![[TXT]](/icons/text.gif) | mengenal-lebih-dekat-intergovernmental-panel-on-climate-change.html | 2026-08-10 02:09 | 49K | |
![[TXT]](/icons/text.gif) | mengenal-istilah-deportasi.html | 2026-08-10 02:09 | 54K | |
![[TXT]](/icons/text.gif) | hipertensi-pada-anak.html | 2026-08-10 02:09 | 108K | |
![[TXT]](/icons/text.gif) | fenomena-long-covid-pada-penyintas.html | 2026-08-10 02:09 | 113K | |
![[TXT]](/icons/text.gif) | fakta-fakta-terkait-kejadian-kematian-penerima-vaksin-pfizer.html | 2026-08-10 02:09 | 113K | |
![[TXT]](/icons/text.gif) | dapatkah-seseorang-dipidana-karena-tidak-mampu-membayar-utang.html | 2026-08-10 02:09 | 55K | |
![[TXT]](/icons/text.gif) | asuransi-properti-dan-covid-19-apakah-kerugian-bisnis-dapat-ditanggung-oleh-pihak-asuransi.html | 2026-08-10 02:09 | 62K | |
![[TXT]](/icons/text.gif) | Valdez, A., and Others. 2021.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Steven Shavell, 1982 The Bell Journal of Economics-On Liability Insurance.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | perkembangan-premi-asuransi-dan-reasuransi-di-indonesia-2016-2018.html | 2026-08-10 02:09 | 48K | |
![[TXT]](/icons/text.gif) | menilik-peran-corporate-communication-sebagai-instrumen-komunikasi-perusahaan.html | 2026-08-10 02:09 | 44K | |
![[TXT]](/icons/text.gif) | mengenal-perbedaan-perseroan-publik-dan-perseroan-terbuka-tbk.html | 2026-08-10 02:09 | 58K | |
![[TXT]](/icons/text.gif) | mengenal-mutasi-vui-20201201.html | 2026-08-10 02:09 | 111K | |
![[TXT]](/icons/text.gif) | mengenal-freight-forwarder-liability-ffl-insurance.html | 2026-08-10 02:09 | 44K | |
![[TXT]](/icons/text.gif) | jenis-jenis-peradila-di-indonesia.html | 2026-08-10 02:09 | 56K | |
![[TXT]](/icons/text.gif) | jaminan-sosial-ketenagakerjaan-implementasi-manfaat-dan-tanggung-jawab-perusahaan-terhadap-keselamatan-kerja.html | 2026-08-10 02:09 | 51K | |
![[TXT]](/icons/text.gif) | hemodialysis.html | 2026-08-10 02:09 | 62K | |
![[TXT]](/icons/text.gif) | covid-19-merupakan-force-majeure-teliti-dulu-pengaturannya.html | 2026-08-10 02:09 | 65K | |
![[TXT]](/icons/text.gif) | bahaya-rip-current-di-pantai-selatan.html | 2026-08-10 02:09 | 43K | |
![[TXT]](/icons/text.gif) | Womack, J., Jones, D., & Roos, D. (2007). The machine that changed the world. New York_ Free Press.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Meria, L., Mariyanti, T., & Maria, I. (2024). Development Of Digital Indonesian Rupiah Through Blockchain Technology. Blockchain Frontier Technology, 3(2), 95-101.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Martono & Ahmad Sudiro. Aviation Laws and Regulations Applicable in Indonesia.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Müller, S., Mathiassen, L., & Balshøj, H. (2010). Software process improvement as organizational change_ A metaphorical analysis of the literature.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | psak-62-kontrak-asuransi.html | 2026-08-10 02:09 | 49K | |
![[TXT]](/icons/text.gif) | penile-cancer.html | 2026-08-10 02:09 | 59K | |
![[TXT]](/icons/text.gif) | menyikapi-penghapusan-ketentuan-waiting-period-pada-seojk-paydi.html | 2026-08-10 02:09 | 116K | |
![[TXT]](/icons/text.gif) | lembaga-alternatif-penyelesaian-sengketa-di-sektor-jasa-keuangan.html | 2026-08-10 02:09 | 55K | |
![[TXT]](/icons/text.gif) | infeksi-saluran-pernapasan-akut.html | 2026-08-10 02:09 | 58K | |
![[TXT]](/icons/text.gif) | infeksi-menular-seksual.html | 2026-08-10 02:09 | 60K | |
![[TXT]](/icons/text.gif) | how-old-are-you.html | 2026-08-10 02:09 | 68K | |
![[TXT]](/icons/text.gif) | coronavirus-dan-epidemiologi.html | 2026-08-10 02:09 | 67K | |
![[TXT]](/icons/text.gif) | awas-sakit-gigi.html | 2026-08-10 02:09 | 63K | |
![[TXT]](/icons/text.gif) | Tennant, G. (2001). Six Sigma_ SPC and TQM in manufacturing and services. Burlington_ VT _ Gower Publishing Company.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Team, T.I238f.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Perka Badan Nasional Pencarian dan Pertolongan No. 8 Tahun 2017 Tentang Organisasi dan Tata Kerja Badan Nasional Pencarian dan Pertolongan.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | IBM Security & Ponemon Institute.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | telaah-imunitas-dalam-disiplin-ilmu-psikoneuroimunologi.html | 2026-08-10 02:09 | 109K | |
![[TXT]](/icons/text.gif) | quick-facts-for-you-urinary-tract-infection-infeksi-saluran-kemih.html | 2026-08-10 02:09 | 57K | |
![[TXT]](/icons/text.gif) | pipe-laying-method-in-offshore-subsea-construction.html | 2026-08-10 02:09 | 51K | |
![[TXT]](/icons/text.gif) | penggunaan-annual-aggregate-deductible-dalam-kontrak-treaty-excess-of-loss.html | 2026-08-10 02:09 | 39K | |
![[TXT]](/icons/text.gif) | mengenal-diet-keto.html | 2026-08-10 02:09 | 110K | |
![[TXT]](/icons/text.gif) | infective-endocarditis.html | 2026-08-10 02:09 | 63K | |
![[TXT]](/icons/text.gif) | encephalitis.html | 2026-08-10 02:09 | 104K | |
![[TXT]](/icons/text.gif) | bertahan-melalui-serangan-jantung.html | 2026-08-10 02:09 | 62K | |
![[TXT]](/icons/text.gif) | bahaya-mengkonsumsi-makanan-dan-minuman-panas.html | 2026-08-10 02:09 | 107K | |
![[TXT]](/icons/text.gif) | Marsh. (2021). Data Center Risk Assessment and Insurance Considerations.html | 2026-08-10 02:09 | 4.4K | |
![[DIR]](/icons/folder.gif) | Kementerian Komunikasi dan Informatika Republik Indonesia. (2022). Undang-Undang Nomor 27 Tahun 2022 tentang Pelindungan Data Pribadi. Retrieved from https_/ | 2026-08-10 02:09 | - | |
![[TXT]](/icons/text.gif) | wacana-sekolah-tatap-muka-di-tengah-pandemi-covid-19.html | 2026-08-10 02:09 | 113K | |
![[TXT]](/icons/text.gif) | teknologi-digital-dan-persaingan-bisnis-netflix-blockbuster.html | 2026-08-10 02:09 | 49K | |
![[TXT]](/icons/text.gif) | sudden-sensorineural-hearing-loss.html | 2026-08-10 02:09 | 111K | |
![[TXT]](/icons/text.gif) | perusahaan-asuransi-vs-lembaga-keuangan-lainnya-dalam-klaim-asuransi.html | 2026-08-10 02:09 | 43K | |
![[TXT]](/icons/text.gif) | penyakit-kronis-pada-anak.html | 2026-08-10 02:09 | 63K | |
![[TXT]](/icons/text.gif) | montreal-convention-1999-for-passenger-and-consumer-protection.html | 2026-08-10 02:09 | 40K | |
![[TXT]](/icons/text.gif) | mengenal-apa-itu-aksi-koporasi.html | 2026-08-10 02:09 | 42K | |
![[TXT]](/icons/text.gif) | melanoma.html | 2026-08-10 02:09 | 61K | |
![[TXT]](/icons/text.gif) | evolusi-dan-agility-clean-inside-lean-outside.html | 2026-08-10 02:09 | 51K | |
![[TXT]](/icons/text.gif) | apa-sih-isi-dari-glasgow-climate-pact.html | 2026-08-10 02:09 | 48K | |
![[TXT]](/icons/text.gif) | Media Asuransi. (2023). Menyoal Urgensi Kenaikan Modal Asuransi dan Reasuransi Edisi 389.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | International Law, a treatise, 8th edition, 1960, vol. One-peace.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | risiko-pabrik-keramik.html | 2026-08-10 02:09 | 40K | |
![[TXT]](/icons/text.gif) | pre-existing-condition-pelaksanaannya-kini-apakah-sudah-sesuai.html | 2026-08-10 02:09 | 45K | |
![[TXT]](/icons/text.gif) | pentingnya-tidur-untuk-kesehatan.html | 2026-08-10 02:09 | 118K | |
![[TXT]](/icons/text.gif) | mengenal-pesawat-n219-milik-indonesia-bagian-1.html | 2026-08-10 02:09 | 40K | |
![[TXT]](/icons/text.gif) | mengenal-hantavirus.html | 2026-08-10 02:09 | 111K | |
![[TXT]](/icons/text.gif) | mengenal-cacar-monyet.html | 2026-08-10 02:09 | 110K | |
![[TXT]](/icons/text.gif) | kalimantan-kok-bisa-terkena-gempa.html | 2026-08-10 02:09 | 42K | |
![[TXT]](/icons/text.gif) | gonorrhea-superbug.html | 2026-08-10 02:09 | 114K | |
![[TXT]](/icons/text.gif) | apakah-warranty-class-maintained-at-the-time-of-accident-overlap-dengan-ketentuan-institute-time-clause-hull-11083.html | 2026-08-10 02:09 | 41K | |
![[TXT]](/icons/text.gif) | Hammer, M. (1990). Reengineering Work_ Don’t Automate, Obliterate.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Galindo, Andrea. 202279ca.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | telaah-ganja-medis-sebagai-alternatif-pengobatan.html | 2026-08-10 02:09 | 116K | |
![[TXT]](/icons/text.gif) | standar-akuntansi-yang-berlaku-1-januari-2020.html | 2026-08-10 02:09 | 51K | |
![[TXT]](/icons/text.gif) | skizofrenia.html | 2026-08-10 02:09 | 114K | |
![[TXT]](/icons/text.gif) | ramalan-kelam-masa-depan-bumi-akibat-pemanasan.html | 2026-08-10 02:09 | 74K | |
![[TXT]](/icons/text.gif) | peran-kolesterol-bagi-kesehatan-tubuh.html | 2026-08-10 02:09 | 108K | |
![[TXT]](/icons/text.gif) | pengaruh-esg-terhadap-profitabilitas-perusahaan.html | 2026-08-10 02:09 | 47K | |
![[TXT]](/icons/text.gif) | machinery-should-breakdown.html | 2026-08-10 02:09 | 39K | |
![[TXT]](/icons/text.gif) | igby C.Jess. 2011.The Insurance of Commercial Risks; Law and Practice. London.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | electric-vehicle-ev-bisnis-baru-menggiurkan-asuransi-kendaraan-bermotor.html | 2026-08-10 02:09 | 49K | |
![[TXT]](/icons/text.gif) | contingent-business-interruption-insurance-cbi.html | 2026-08-10 02:09 | 45K | |
![[TXT]](/icons/text.gif) | Sutedi, E. 2013. Potensi Telang (Clitoria ternatea) sebagai Tanaman Pakan Ternak.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Meliala, Djaja S., Perkembangan Hukum Perdata Tentang Benda dan Hukum Perikatan.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Grover, V., & Markus, L. (2008). Business Process Transformation. New York_ M. E.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Baur, D. G., & McDermott, T. K. (2010)6423.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | virus-flu-babi-g4-ea-h1n1-akankan-menjadi-pandemi-baru-di-tahun-ini.html | 2026-08-10 02:09 | 111K | |
![[TXT]](/icons/text.gif) | vaksin-cacar-air-penting-atau-tidak.html | 2026-08-10 02:09 | 107K | |
![[TXT]](/icons/text.gif) | tentang-varian-mutasi-b-117-yang-hadir-di-indonesia.html | 2026-08-10 02:09 | 110K | |
![[TXT]](/icons/text.gif) | tahan-banting-selama-puasa.html | 2026-08-10 02:09 | 112K | |
![[TXT]](/icons/text.gif) | menghadapi-unfair-situation-di-pasar-internasional.html | 2026-08-10 02:09 | 41K | |
![[TXT]](/icons/text.gif) | keterkaitan-infeksi-covid-dengan-hepatitis-misterius.html | 2026-08-10 02:09 | 111K | |
![[TXT]](/icons/text.gif) | intellectual-property-insurance.html | 2026-08-10 02:09 | 67K | |
![[TXT]](/icons/text.gif) | gangguan-bipolar.html | 2026-08-10 02:09 | 64K | |
![[TXT]](/icons/text.gif) | fenomena-glass-ceiling-hambatan-wanita-dalam-berkarier.html | 2026-08-10 02:09 | 45K | |
![[TXT]](/icons/text.gif) | application-of-fibre-optic-cables-in-offshore-and-subsea-environment.html | 2026-08-10 02:09 | 63K | |
![[TXT]](/icons/text.gif) | tahukah-kamu-tentang-asuransi-hewan-peliharaan-.html | 2026-08-10 02:09 | 53K | |
![[TXT]](/icons/text.gif) | proses-produksi-dan-risiko-pabrik-plastik-injection-molding.html | 2026-08-10 02:09 | 43K | |
![[TXT]](/icons/text.gif) | mungkinkah-covid-19-terjadi-pada-hewan.html | 2026-08-10 02:09 | 109K | |
![[TXT]](/icons/text.gif) | hiv-dan-aids.html | 2026-08-10 02:09 | 60K | |
![[TXT]](/icons/text.gif) | flurona-infeksi-apakah-itu.html | 2026-08-10 02:09 | 111K | |
![[TXT]](/icons/text.gif) | fenomena-antibody-dependent-enhancement-ade-pada-sistem-imun.html | 2026-08-10 02:09 | 115K | |
![[TXT]](/icons/text.gif) | customer-due-diligence-cdd-bagi-penyedia-jasa-keuangan.html | 2026-08-10 02:09 | 57K | |
![[DIR]](/icons/folder.gif) | World Health Organization. (2021). WHO/ | 2026-08-10 02:09 | - | |
![[TXT]](/icons/text.gif) | Undang-undang No.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Pusat Informasi Iklim Kedeputian Bidang Klimatologi Badan Meteorologi Klimatologi dan Geofisika. 2024. Tahun MMXXIV No. 06 Juni 2024 Buletin Informasi Iklim Juni.html | 2026-08-10 02:09 | 4.4K | |
![[DIR]](/icons/folder.gif) | Mutaqin, D.J. & Usami, K. (2019). Smallholder f/ | 2026-08-10 02:09 | - | |
![[TXT]](/icons/text.gif) | MSCI Inc. (2023). MSCI Global Investable Market Indexes methodology. MSCI Index Research.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | risiko-peluncuran-kapal.html | 2026-08-10 02:09 | 44K | |
![[TXT]](/icons/text.gif) | proses-pengelolaan-masker-medis-bekas-pakai.html | 2026-08-10 02:09 | 108K | |
![[TXT]](/icons/text.gif) | pemanfaatan-kecerdasan-buatan-ai-dalam-industri-asuransi.html | 2026-08-10 02:09 | 43K | |
![[TXT]](/icons/text.gif) | okupasi-23005-cat-dan-pernis.html | 2026-08-10 02:09 | 43K | |
![[TXT]](/icons/text.gif) | mitos-dan-fakta-tentang-covid-19.html | 2026-08-10 02:09 | 112K | |
![[TXT]](/icons/text.gif) | hepatitis-e.html | 2026-08-10 02:09 | 59K | |
![[TXT]](/icons/text.gif) | fungsi-sebenarnya-meterai-dalam-perjanjian.html | 2026-08-10 02:09 | 54K | |
![[TXT]](/icons/text.gif) | eksepsi-dalam-hukum-perdata.html | 2026-08-10 02:09 | 57K | |
![[TXT]](/icons/text.gif) | Moran, M. J., Shapiro, H. N., Boettner, D. D. & Bailey, M. B., 2014. Fundamentals of Engineering Thermodynamics. 8th ed. s.l._Wilet.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Eckhoff, R. K., & Li, G. (2021). Industrial Dust Explosions. A Brief Review. Applied Sciences, 11(4), 1669.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | 5-lima-langkah-menentukan-kontrak-psak-72-bagian-1.html | 2026-08-10 02:09 | 55K | |
![[TXT]](/icons/text.gif) | zero-covid-policy.html | 2026-08-10 02:09 | 110K | |
![[TXT]](/icons/text.gif) | sertifikat-keselamatan-sebagai-salah-satu-syarat-kelaiklautan-kapal-menurut-undang-undang-pelayaran-no-17-tahun-2008.html | 2026-08-10 02:09 | 44K | |
![[TXT]](/icons/text.gif) | rhabdomyolysis-bahaya-tersembunyi-di-balik-tren-olahraga-ekstrem.html | 2026-08-10 02:09 | 45K | |
![[TXT]](/icons/text.gif) | peran-reasuransi-dalam-makro-ekonomi.html | 2026-08-10 02:09 | 41K | |
![[TXT]](/icons/text.gif) | para-pelengkap-bmi.html | 2026-08-10 02:09 | 60K | |
![[TXT]](/icons/text.gif) | mengantisipasi-low-agreed-value-underinsured-dalam-asuransi-kapal.html | 2026-08-10 02:09 | 44K | |
![[TXT]](/icons/text.gif) | melawan-stigma-langkah-pemerintah-indonesia-dalam-mengatasi-gangguan-mental.html | 2026-08-10 02:09 | 43K | |
![[TXT]](/icons/text.gif) | kegagalan-pada-transformer.html | 2026-08-10 02:09 | 51K | |
![[TXT]](/icons/text.gif) | keabsahan-dan-konsekuensi-melakukan-perubahan-tanda-tangan.html | 2026-08-10 02:09 | 54K | |
![[TXT]](/icons/text.gif) | introduction-ifrs-17.html | 2026-08-10 02:09 | 39K | |
![[TXT]](/icons/text.gif) | asuransi-wajib-kendaraan-bermotor-sudahkah-saatnya.html | 2026-08-10 02:09 | 44K | |
![[TXT]](/icons/text.gif) | Indonesia Law Number 15 of 1992 on Aviation.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | BPS, (2017). Statistic Indonesia. Retrieved from www.bps.go.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | penyakit-virus-zika.html | 2026-08-10 02:09 | 81K | |
![[TXT]](/icons/text.gif) | pencemaran-nama-baik-di-sosial-media.html | 2026-08-10 02:09 | 54K | |
![[TXT]](/icons/text.gif) | mengkonsumsi-vitamin-c.html | 2026-08-10 02:09 | 114K | |
![[TXT]](/icons/text.gif) | lebih-dekat-dengan-profesi-notaris-di-indonesia-.html | 2026-08-10 02:09 | 47K | |
![[TXT]](/icons/text.gif) | kewajiban-menggunakan-mata-uang-rupiah-di-wilayah-nkri.html | 2026-08-10 02:09 | 61K | |
![[TXT]](/icons/text.gif) | institute-time-clauses-hulls-disbursement-and-increased-value.html | 2026-08-10 02:09 | 49K | |
![[TXT]](/icons/text.gif) | ever-given-memblokade-suez-canal-dan-antisipasi-asuransi-terhadap-ganti-rugi-yang-akan-terjadi.html | 2026-08-10 02:09 | 51K | |
![[TXT]](/icons/text.gif) | apa-sih-negative-interest-rate.html | 2026-08-10 02:09 | 53K | |
![[TXT]](/icons/text.gif) | Weiss, Colin (2025)29b7.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | 2019-novel-coronavirus.html | 2026-08-10 02:09 | 134K | |
![[TXT]](/icons/text.gif) | ths-collision-liability-cross-liability.html | 2026-08-10 02:09 | 41K | |
![[TXT]](/icons/text.gif) | penerapan-sustainable-development-goals-sdgs-dalam-operasional-industri-perasuransian-nasional.html | 2026-08-10 02:09 | 121K | |
![[TXT]](/icons/text.gif) | part-2-proteksi-kepada-perusahaan-pelayaran-dari-dampak-covid-19.html | 2026-08-10 02:09 | 58K | |
![[TXT]](/icons/text.gif) | nuclear-nerds-jenis-limbah-nuklir.html | 2026-08-10 02:09 | 42K | |
![[TXT]](/icons/text.gif) | kanker-pankreas.html | 2026-08-10 02:09 | 107K | |
![[TXT]](/icons/text.gif) | hipnosis-dan-diet-hipnoterapi.html | 2026-08-10 02:09 | 118K | |
![[TXT]](/icons/text.gif) | aset-tetap-atau-properti-investasi.html | 2026-08-10 02:09 | 46K | |
![[TXT]](/icons/text.gif) | Republic of Indonesia Government (2004) ‘UndangUndang RI Nomor 40 Tahun 2004 Tentang Keselamatan Kerja’. Jakarta.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Ministère de L'agriculture et de L'alimentation (N.D). supra note 30.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | International Rescue Committee. 2023cfb1.html | 2026-08-10 02:09 | 4.4K | |
![[DIR]](/icons/folder.gif) | Castillo-Huitrón, N.M., Eduardo J. Naranjo, E.J/ | 2026-08-10 02:09 | - | |
![[TXT]](/icons/text.gif) | 4.Mitigasi Gempa Bumi, Langkah yang Harus Dilakukan. kompas.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | transplantasi-kornea.html | 2026-08-10 02:09 | 60K | |
![[TXT]](/icons/text.gif) | program-vaksinasi-gotong-royong.html | 2026-08-10 02:09 | 110K | |
![[TXT]](/icons/text.gif) | potret-wabah-pneumonia-misterius-di-indonesia-dan-dunia.html | 2026-08-10 02:09 | 115K | |
![[TXT]](/icons/text.gif) | pemberian-dosis-booster-pada-program-vaksinasi-covid-di-indonesia.html | 2026-08-10 02:09 | 109K | |
![[TXT]](/icons/text.gif) | menimbang-kendaraan-hidrogen-sebagai-penantang-kendaraan-listrik.html | 2026-08-10 02:09 | 42K | |
![[TXT]](/icons/text.gif) | mengenal-covid-19-varian-jn1.html | 2026-08-10 02:09 | 110K | |
![[TXT]](/icons/text.gif) | manfaat-ikan-salmon.html | 2026-08-10 02:09 | 111K | |
![[TXT]](/icons/text.gif) | hyperventilation-syndrome.html | 2026-08-10 02:09 | 110K | |
![[TXT]](/icons/text.gif) | difteri.html | 2026-08-10 02:09 | 59K | |
![[TXT]](/icons/text.gif) | What Is The Hantavirus That Caused The Death of Hollywood Actor Gene Heckman’s Wife4e29.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | simple-interest-compound-intrest.html | 2026-08-10 02:09 | 40K | |
![[TXT]](/icons/text.gif) | proses-pembuatan-gula-tebu-dan-risiko-pabrik-gula.html | 2026-08-10 02:09 | 43K | |
![[TXT]](/icons/text.gif) | potensi-terjadinya-cross-reactive-immunity-terhadap-individu-yang-belum-terekspos-sars-cov-2.html | 2026-08-10 02:09 | 112K | |
![[TXT]](/icons/text.gif) | perbedaan-profesi-hukum-likuidator-dan-kurator.html | 2026-08-10 02:09 | 53K | |
![[TXT]](/icons/text.gif) | penggunaan-air-purifier-apakah-merupakan-solusi-efektif-untuk-mengatasi-gangguan-pernapasan-akibat-kualitas-udara-buruk.html | 2026-08-10 02:09 | 120K | |
![[TXT]](/icons/text.gif) | mengenal-disease-x-the-future-next-pandemic.html | 2026-08-10 02:09 | 113K | |
![[TXT]](/icons/text.gif) | ketika-risiko-siber-mengancam-solvabilitas-dan-kapasitas-industri-reasuransi.html | 2026-08-10 02:09 | 43K | |
![[TXT]](/icons/text.gif) | bahayakah-menghisap-shisha.html | 2026-08-10 02:09 | 61K | |
![[TXT]](/icons/text.gif) | apakah-nft-dapat-diasuransikan-1.html | 2026-08-10 02:09 | 47K | |
![[DIR]](/icons/folder.gif) | Manajemen Risiko Perusahaan Perasuransian _ Penerapan pada level Operasional/ | 2026-08-10 02:09 | - | |
![[TXT]](/icons/text.gif) | Kasmir, Bank dan Lembaga Keuangan Lainnya.html | 2026-08-10 02:09 | 4.4K | |
![[DIR]](/icons/folder.gif) | Deloitte. (2023). Data Privacy in Insurance_ From Compliance to Competitive Advantage. Retrieved from https_/ | 2026-08-10 02:09 | - | |
![[TXT]](/icons/text.gif) | BSSN.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | urgensi-dan-implementasi-pelindungan-data-pribadi-pdp--di-industri-asuransi-jiwa-dan-kesehatan.html | 2026-08-10 02:09 | 113K | |
![[TXT]](/icons/text.gif) | serba-serbi-tonsil.html | 2026-08-10 02:09 | 109K | |
![[TXT]](/icons/text.gif) | serba-serbi-sakit-pinggang.html | 2026-08-10 02:09 | 110K | |
![[TXT]](/icons/text.gif) | pentingnya-sroi-dalam-pengukuran-dampak-program-inovasi-sosial.html | 2026-08-10 02:09 | 45K | |
![[TXT]](/icons/text.gif) | ocean-conveyor-belt.html | 2026-08-10 02:09 | 41K | |
![[TXT]](/icons/text.gif) | mengenal-perbedaan-gugatan-dan-permohonan.html | 2026-08-10 02:09 | 64K | |
![[TXT]](/icons/text.gif) | kanker-payudara-pada-wanita-muda.html | 2026-08-10 02:09 | 66K | |
![[TXT]](/icons/text.gif) | employers-liability-dan-workmen-compensation-insurance.html | 2026-08-10 02:09 | 45K | |
![[TXT]](/icons/text.gif) | delirium-pada-penderita-covid-19.html | 2026-08-10 02:09 | 110K | |
![[TXT]](/icons/text.gif) | bitcoin-or-gold.html | 2026-08-10 02:09 | 44K | |
![[TXT]](/icons/text.gif) | Swiss Re Institute. (2023). Natural catastrophes and inflation in 2022_ a perfect storm. Sigma, 1(2023).html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Prof. Dr. Eddy O.S. Hiariej, S.H., M.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | sanction-clause.html | 2026-08-10 02:09 | 44K | |
![[TXT]](/icons/text.gif) | proses-pembuatan-vaksin.html | 2026-08-10 02:09 | 113K | |
![[TXT]](/icons/text.gif) | pneumonia.html | 2026-08-10 02:09 | 105K | |
![[TXT]](/icons/text.gif) | peningkatan-kasus-covid-19-pada-anak-di-indonesia.html | 2026-08-10 02:09 | 112K | |
![[TXT]](/icons/text.gif) | kanker-cervix.html | 2026-08-10 02:09 | 58K | |
![[TXT]](/icons/text.gif) | industrie-40-penerapan-nasional-skala-global-industry-40-di-jerman.html | 2026-08-10 02:09 | 52K | |
![[TXT]](/icons/text.gif) | hepatitis-misterius.html | 2026-08-10 02:09 | 113K | |
![[TXT]](/icons/text.gif) | gangguan-kesehatan-akibat-banjir.html | 2026-08-10 02:09 | 60K | |
![[TXT]](/icons/text.gif) | cashless-society.html | 2026-08-10 02:09 | 44K | |
![[TXT]](/icons/text.gif) | Undang-Undang Nomor 2 Tahun 2008 tentang Bank Indonesia.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Harry Duintjer Tebbens. 1980. International Product Liability _ A study comparative and international legal aspects of product liability, T.M.C.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | -Caroline Maria M. dan Harjono. Studi Kajian tentang Gugatan Intervensi dalam Perkara Perdata. Jurnal Verstek - Fakultas Hukum Universitas Sebelas Maret, Vol. 8, No.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | telaah-penggunaan-azithromycin-dalam-pengobatan-covid-19.html | 2026-08-10 02:09 | 112K | |
![[TXT]](/icons/text.gif) | perbedaan-wanprestasi-dan-perbuatan-melawan-hukum.html | 2026-08-10 02:09 | 55K | |
![[TXT]](/icons/text.gif) | pentingnya-kalsium-untuk-tubuh.html | 2026-08-10 02:09 | 113K | |
![[TXT]](/icons/text.gif) | nuclear-nerds-apa-itu-nuklir.html | 2026-08-10 02:09 | 46K | |
![[TXT]](/icons/text.gif) | narkoba.html | 2026-08-10 02:09 | 60K | |
![[TXT]](/icons/text.gif) | mitral-valve-regurgitation.html | 2026-08-10 02:09 | 61K | |
![[TXT]](/icons/text.gif) | mengenal-cop26-di-glasgow.html | 2026-08-10 02:09 | 48K | |
![[TXT]](/icons/text.gif) | mendapatkan-status-sebagai-warga-negara-indonesia.html | 2026-08-10 02:09 | 58K | |
![[TXT]](/icons/text.gif) | melakukan-tindak-pidana-di-negara-lain.html | 2026-08-10 02:09 | 53K | |
![[TXT]](/icons/text.gif) | ebola-virus-disease-ebv.html | 2026-08-10 02:09 | 62K | |
![[TXT]](/icons/text.gif) | berpikir-warna--warni--metode-kreatif-problem-solving--dengan-teori-enam-topi-berpikir.html | 2026-08-10 02:09 | 44K | |
![[DIR]](/icons/folder.gif) | -Prof. Dr. Emi Emilia dan Tim. 2017. Terjemahan/ | 2026-08-10 02:09 | - | |
![[TXT]](/icons/text.gif) | yuk-kenali-bagaimana-listrik-dapat-dihasilkan.html | 2026-08-10 02:09 | 50K | |
![[TXT]](/icons/text.gif) | tanaman-sawit-di-lahan-gambut.html | 2026-08-10 02:09 | 49K | |
![[TXT]](/icons/text.gif) | penjaminan-dan-asuransi-berbeda-tapi-sama.html | 2026-08-10 02:09 | 44K | |
![[TXT]](/icons/text.gif) | mengoptimalkan-kekebalan-tubuh.html | 2026-08-10 02:09 | 111K | |
![[TXT]](/icons/text.gif) | mengenal-startup-dan-seri-pendanaan-nya.html | 2026-08-10 02:09 | 55K | |
![[TXT]](/icons/text.gif) | klasifikasi-risiko-berdasarkan-peluang-terkena-penyakit-cardiovascular.html | 2026-08-10 02:09 | 45K | |
![[TXT]](/icons/text.gif) | fit-and-proper-test-reassesment.html | 2026-08-10 02:09 | 56K | |
![[TXT]](/icons/text.gif) | emas-dan-anomali-risiko-dalam-investasi.html | 2026-08-10 02:09 | 47K | |
![[TXT]](/icons/text.gif) | covid-subvarian-xbb-dan-xbc.html | 2026-08-10 02:09 | 111K | |
![[TXT]](/icons/text.gif) | covid-19-dan-penyakit-kardiovaskular.html | 2026-08-10 02:09 | 108K | |
![[TXT]](/icons/text.gif) | bukan-sekadar-jumlah-mengenal-konsep-aset-yang-diperkenankan-dalam-industri-asuransi.html | 2026-08-10 02:09 | 45K | |
![[TXT]](/icons/text.gif) | IAEA. 20227087.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | waspada-antraks-menjelang-idul-adha.html | 2026-08-10 02:09 | 111K | |
![[TXT]](/icons/text.gif) | surat-hutang-berumur-100-tahun.html | 2026-08-10 02:09 | 56K | |
![[TXT]](/icons/text.gif) | relevansi-employers-dual-capacity-dan-wci-dalam-bisnis-produk-dan-jasa.html | 2026-08-10 02:09 | 41K | |
![[TXT]](/icons/text.gif) | perdagangan-negara-dan-nilai-tukar.html | 2026-08-10 02:09 | 52K | |
![[TXT]](/icons/text.gif) | pemberian-hibah-menurut-hukum-di-indonesia.html | 2026-08-10 02:09 | 55K | |
![[TXT]](/icons/text.gif) | mental-health-awareness-di-lingkungan-kerja.html | 2026-08-10 02:09 | 112K | |
![[TXT]](/icons/text.gif) | mengenal-kandung-empedu.html | 2026-08-10 02:09 | 110K | |
![[TXT]](/icons/text.gif) | investasi-emas-di-masa-pandemi-akankah-terus-berkilau.html | 2026-08-10 02:09 | 50K | |
![[TXT]](/icons/text.gif) | hati-hati-promosikan-investasi-bodong-dapat-dipidana.html | 2026-08-10 02:09 | 47K | |
![[TXT]](/icons/text.gif) | barge-jumbo-sangat-rentan-loss.html | 2026-08-10 02:09 | 44K | |
![[TXT]](/icons/text.gif) | artificial-intelligence-how-it-benefits-businesses.html | 2026-08-10 02:09 | 52K | |
![[TXT]](/icons/text.gif) | risk-capacity-risk-appetite-dan-risk-tolerance-by-msopian-dollof.html | 2026-08-10 02:09 | 41K | |
![[TXT]](/icons/text.gif) | port-authority-liability.html | 2026-08-10 02:09 | 40K | |
![[TXT]](/icons/text.gif) | pesawat-udara-sebagai-agunan-kredit.html | 2026-08-10 02:09 | 42K | |
![[TXT]](/icons/text.gif) | pemberian-vaksin-pfizer-pada-anak.html | 2026-08-10 02:09 | 112K | |
![[TXT]](/icons/text.gif) | pandemic-fatigue.html | 2026-08-10 02:09 | 110K | |
![[TXT]](/icons/text.gif) | mengenal-event-cancellation-insurance-asuransi-pembatalan-acara.html | 2026-08-10 02:09 | 44K | |
![[TXT]](/icons/text.gif) | mekanisme-pengadaan-kapal-untuk-mendorong-realisasi-asas-beyond-cabotage.html | 2026-08-10 02:09 | 45K | |
![[TXT]](/icons/text.gif) | inflasi-medis-dan-masa-depan-asuransi-kesehatan-indonesia-.html | 2026-08-10 02:09 | 116K | |
![[TXT]](/icons/text.gif) | donggala-2018-gempa-tsunami-dan-likuifaksi.html | 2026-08-10 02:09 | 41K | |
![[TXT]](/icons/text.gif) | Undang-Undang No-2.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | 2.Update Korban Gempa Cianjur 27 November 2022, Korban Jiwa Bertambah. databooks.katadata.co.id.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | yang-perlu-diketahui-tentang-sample-dan-sampling.html | 2026-08-10 02:09 | 43K | |
![[TXT]](/icons/text.gif) | ulkus-lambung.html | 2026-08-10 02:09 | 108K | |
![[TXT]](/icons/text.gif) | the-fed-dan-arah-kebijakan-memangkas-suku-bunga.html | 2026-08-10 02:09 | 50K | |
![[TXT]](/icons/text.gif) | perbedaan-delik-aduan-dan-delik-biasa.html | 2026-08-10 02:09 | 54K | |
![[TXT]](/icons/text.gif) | meningkatnya-pinjaman-online-demi-war-tiket-coldplay.html | 2026-08-10 02:09 | 40K | |
![[TXT]](/icons/text.gif) | mengenal-cacar-monyet-1.html | 2026-08-10 02:09 | 114K | |
![[TXT]](/icons/text.gif) | marburg-virus-disease.html | 2026-08-10 02:09 | 110K | |
![[TXT]](/icons/text.gif) | hole-in-one-insurance-perlindungan-asuransi-bagi-turnamen-golf.html | 2026-08-10 02:09 | 45K | |
![[TXT]](/icons/text.gif) | fenomena-peningkatan-insidensi-hivaids-pada-ibu-rumah-tangga.html | 2026-08-10 02:09 | 114K | |
![[TXT]](/icons/text.gif) | Nkomo, A., & Marnewick, C. (2021). Improving the success rate of business process re-engineering projects_ A business process re-engineering framework.html | 2026-08-10 02:09 | 4.4K | |
![[DIR]](/icons/folder.gif) | Manajemen risiko _ panduan untuk risk leaders dan risk practitioners _ ISO 31000_2018/ | 2026-08-10 02:09 | - | |
![[TXT]](/icons/text.gif) | vaksin-covid-19-untuk-ibu-hamil.html | 2026-08-10 02:09 | 107K | |
![[TXT]](/icons/text.gif) | tentang-vaksin-sputnik-v-.html | 2026-08-10 02:09 | 106K | |
![[TXT]](/icons/text.gif) | stroke-batang-otak.html | 2026-08-10 02:09 | 115K | |
![[TXT]](/icons/text.gif) | mengenal-gerd-1.html | 2026-08-10 02:09 | 112K | |
![[TXT]](/icons/text.gif) | ketika-influenza-berevolusi-super-flu-dan-tantangan-sistem-kesehatan.html | 2026-08-10 02:09 | 115K | |
![[TXT]](/icons/text.gif) | hepatitis-d.html | 2026-08-10 02:09 | 58K | |
![[TXT]](/icons/text.gif) | dampak-covid-19-terhadap-industri-pelayaran.html | 2026-08-10 02:09 | 53K | |
![[TXT]](/icons/text.gif) | currency-fluctuation-clause.html | 2026-08-10 02:09 | 43K | |
![[TXT]](/icons/text.gif) | agile-organization-the-answer-of-current-business-environment.html | 2026-08-10 02:09 | 47K | |
![[TXT]](/icons/text.gif) | Universal Declaration of Human Rights 1948.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | providing-a-playground-for-insurtech-through-the-regulatory-sandbox.html | 2026-08-10 02:09 | 45K | |
![[TXT]](/icons/text.gif) | penyakit-virus-hendra.html | 2026-08-10 02:09 | 108K | |
![[TXT]](/icons/text.gif) | pembentukan-peraturan-perundang-undangan.html | 2026-08-10 02:09 | 59K | |
![[TXT]](/icons/text.gif) | pemanfaatan-blockchain-dalam-perlindungan-data-pribadi.html | 2026-08-10 02:09 | 42K | |
![[TXT]](/icons/text.gif) | long-covid-dalam-perspektif-asuransi-jiwa-dan-kesehatan.html | 2026-08-10 02:09 | 117K | |
![[TXT]](/icons/text.gif) | kolesterol-tinggi-bisa-karena-keturunan-ngga-sih.html | 2026-08-10 02:09 | 64K | |
![[TXT]](/icons/text.gif) | friendly-reminder-pendirian-lembaga-penjamin-polis.html | 2026-08-10 02:09 | 46K | |
![[TXT]](/icons/text.gif) | asas-asas-hukum-acara-pidana.html | 2026-08-10 02:09 | 61K | |
![[DIR]](/icons/folder.gif) | Santos, M. P. M. M. (2022). New product definit/ | 2026-08-10 02:09 | - | |
![[TXT]](/icons/text.gif) | Role of Reinsurance in the World, Leonardo Caruana de las Cagigas, André Straus, Published By_ Palgrave Macmillan Cham.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Administration, N. H. 2018. NHTSA Safety Alert_ Water Hammer Damage to Vehicle Engines.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | -antibody-dependent-enhancement.html | 2026-08-10 02:09 | 109K | |
![[TXT]](/icons/text.gif) | proyek-mini-hydro-power-plant-tipe-run-off-river.html | 2026-08-10 02:09 | 43K | |
![[TXT]](/icons/text.gif) | prosedur-pelaporan-dugaan-tindak-pidana-ke-polisi.html | 2026-08-10 02:09 | 55K | |
![[TXT]](/icons/text.gif) | mengenal-geostatistics.html | 2026-08-10 02:09 | 44K | |
![[TXT]](/icons/text.gif) | mengenal-data-breach-pelanggaran-data.html | 2026-08-10 02:09 | 49K | |
![[TXT]](/icons/text.gif) | kanker-ginjal.html | 2026-08-10 02:09 | 60K | |
![[TXT]](/icons/text.gif) | institute-additional-perils-clause-11083-cl-294.html | 2026-08-10 02:09 | 44K | |
![[TXT]](/icons/text.gif) | horror-menopause-bagi-wanita.html | 2026-08-10 02:09 | 62K | |
![[TXT]](/icons/text.gif) | cedera-sambaran-petir.html | 2026-08-10 02:09 | 115K | |
![[TXT]](/icons/text.gif) | Megasari, R. A. (2022). Analysis of work accidents and work accident benefits in 2016 in East Java.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Madya, S. D. O., & Nurwahyuni, A. (2019). ACCIDENT INSURANCE FOR INFORMAL SECTOR WORKERS IN INDONESIA. Media Kesehatan Politeknik Kesehatan Makassar, 14(1), 95-103.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Journal Transformation of Mandalika. Vol , No.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | FM Global. (2022). Property Risk Management in Critical Facilities.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | waspada-peningkatan-kasus-hmpv-di-china.html | 2026-08-10 02:09 | 109K | |
![[TXT]](/icons/text.gif) | umkm-di-era-pasar-bebas.html | 2026-08-10 02:09 | 52K | |
![[TXT]](/icons/text.gif) | rekomendasi-terbaru-kemenkes-untuk-vaksinasi-covid-19.html | 2026-08-10 02:09 | 111K | |
![[TXT]](/icons/text.gif) | menilik-kesiapan-indonesia-vs-negara-tetangga-dalam-melangkah-ke-status-endemi.html | 2026-08-10 02:09 | 118K | |
![[TXT]](/icons/text.gif) | mengenal-andropause.html | 2026-08-10 02:09 | 59K | |
![[TXT]](/icons/text.gif) | insurtech-an-opportunity-disguised-as-a-threat-1.html | 2026-08-10 02:09 | 44K | |
![[TXT]](/icons/text.gif) | fungsi-usus-buntu.html | 2026-08-10 02:09 | 107K | |
![[TXT]](/icons/text.gif) | efusi-pleura.html | 2026-08-10 02:09 | 105K | |
![[TXT]](/icons/text.gif) | KPMG. 2020. First Impressions_ IFRS 17 Insurance Contracts.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | potensi-dan-langkah-mitigasi-bahaya-rokok-elektrik.html | 2026-08-10 02:09 | 114K | |
![[TXT]](/icons/text.gif) | peranan-vitamin-d-dalam-imunitas.html | 2026-08-10 02:09 | 113K | |
![[TXT]](/icons/text.gif) | pemanasan-global-adalah-sebuah-mimpi-buruk.html | 2026-08-10 02:09 | 61K | |
![[TXT]](/icons/text.gif) | okupasi-2372-minyak-esensial.html | 2026-08-10 02:09 | 47K | |
![[TXT]](/icons/text.gif) | mengenal-istilah-hukum-piercing-the-corporate-veil.html | 2026-08-10 02:09 | 56K | |
![[TXT]](/icons/text.gif) | membedah-tiga-pilar-manajemen-risiko-operasional-rcsa-led-dan-kri.html | 2026-08-10 02:09 | 48K | |
![[TXT]](/icons/text.gif) | kanker-prostat.html | 2026-08-10 02:09 | 63K | |
![[TXT]](/icons/text.gif) | kanker-hati.html | 2026-08-10 02:09 | 59K | |
![[TXT]](/icons/text.gif) | Sutan Remy Sjahdeini. Sejarah, Asas, dan Teori Hukum Kepailitan. Jakarta_ Prenadamedia Group, 2016.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Indonesia Law Number 1 of 2009 on Aviation.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Fitch Ratings. (2026, March 4). Fitch revises Indonesia outlook to negative; affirms at BBB. Fitch Ratings.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Detik Health (2026)c7df.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Andrea, C. A. (2019). Judicial review of pet insurance in Indonesia. [Thesis].html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Andi Hamzah, Hukum Acara Pidana Indonesia, Jakarta_ Sinar Grafika, 2008.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | tentang-varian-mu.html | 2026-08-10 02:09 | 109K | |
![[TXT]](/icons/text.gif) | sepak-terjang-streptococcal-toxic-shock-syndrome-stss.html | 2026-08-10 02:09 | 111K | |
![[TXT]](/icons/text.gif) | pipe-in-pipe-system-in-oil-and-gas-industry-part-i.html | 2026-08-10 02:09 | 41K | |
![[TXT]](/icons/text.gif) | perspektif-kepemilikan-asuransi-penyakit-kritis-bagi-kelompok-usia-muda.html | 2026-08-10 02:09 | 112K | |
![[TXT]](/icons/text.gif) | mengenal-objek-pertanggungan-pada-polis-par-dan-cmi.html | 2026-08-10 02:09 | 48K | |
![[TXT]](/icons/text.gif) | mengenal-insomnia-dan-sleep-deprivation.html | 2026-08-10 02:09 | 110K | |
![[TXT]](/icons/text.gif) | mengenal-asuransi-barang-bergerak-moveable-all-risks-insurance.html | 2026-08-10 02:09 | 44K | |
![[TXT]](/icons/text.gif) | cacar-air.html | 2026-08-10 02:09 | 59K | |
![[TXT]](/icons/text.gif) | bronkitis-di-musim-hujan.html | 2026-08-10 02:09 | 60K | |
![[TXT]](/icons/text.gif) | telaah-fenomena-gagal-ginjal-akut-pada-anak.html | 2026-08-10 02:09 | 111K | |
![[TXT]](/icons/text.gif) | riwayat-pandemi-flu-spanyol-1918.html | 2026-08-10 02:09 | 114K | |
![[TXT]](/icons/text.gif) | mengenal-ux-process.html | 2026-08-10 02:09 | 41K | |
![[TXT]](/icons/text.gif) | mengenal-tropical-cyclone-dan-potensi-kerusakannya.html | 2026-08-10 02:09 | 53K | |
![[TXT]](/icons/text.gif) | manajemen-risiko-dan-lingkungan-sosial-tata-kelola-esg-paradigma-baru-untuk-bisnis-yang-berkelanjutan.html | 2026-08-10 02:09 | 41K | |
![[TXT]](/icons/text.gif) | lonjakan-kasus-covid-19-di-akhir-tahun-2023.html | 2026-08-10 02:09 | 114K | |
![[TXT]](/icons/text.gif) | gangguan-psikosomatis.html | 2026-08-10 02:09 | 111K | |
![[TXT]](/icons/text.gif) | bagaimana-mengetahui-lapisan-bumi-yang-tidak-dapat-ditembus-oleh-pengeboran.html | 2026-08-10 02:09 | 43K | |
![[TXT]](/icons/text.gif) | a-brief-history-of-music-episode-1-masa-pra-sejarah-sampai-masa-abad-pertengahan.html | 2026-08-10 02:09 | 60K | |
![[TXT]](/icons/text.gif) | UNDANG-UNDANG REPUBLIK INDONESIA NOMOR 29 TAHUN 2014 TENTANG PENCARIAN DAN PERTOLONGAN.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | MSCI Inc. (2026, May 12). MSCI Global Standard Indexes May 2026 Index Review. MSCI Global Standard Indexes.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Ikatan Akuntansi Indonesia (IAI). 2024. Pernyataan Standar Akuntansi Keuangan (PSAK) No 117_ Kontrak Asuransi .html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | BBC News Indonesia (2026)95ea.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | teknologi-hepa-filter.html | 2026-08-10 02:09 | 42K | |
![[TXT]](/icons/text.gif) | rheumatic-heart-disease.html | 2026-08-10 02:09 | 61K | |
![[TXT]](/icons/text.gif) | pentingnya-warna-urine-sebagai-indikator-kesehatan.html | 2026-08-10 02:09 | 109K | |
![[TXT]](/icons/text.gif) | memahami-liability-insurance--asuransi-tanggung-jawab-hukum-.html | 2026-08-10 02:09 | 41K | |
![[TXT]](/icons/text.gif) | london-market-defect-exclusion-de-untuk-menjamin-faulty-design-bad-workmanship-dan-defective-material.html | 2026-08-10 02:09 | 53K | |
![[TXT]](/icons/text.gif) | ketika-terjadi-kecelakaan-pesawat-siapa-penanggung-biaya-operasi-sar-dan-biaya-investigasi-kecelakaan.html | 2026-08-10 02:09 | 40K | |
![[TXT]](/icons/text.gif) | investasi-emas-alternatif-investasi.html | 2026-08-10 02:09 | 47K | |
![[TXT]](/icons/text.gif) | flu-burung-clade-2344b.html | 2026-08-10 02:09 | 115K | |
![[TXT]](/icons/text.gif) | crimean-congo-hemorrhagic-fever.html | 2026-08-10 02:09 | 116K | |
![[DIR]](/icons/folder.gif) | PwC. (2022). Protecting Personal Data in a Hyper-connected Insurance Sector. Retrieved from https_/ | 2026-08-10 02:09 | - | |
![[TXT]](/icons/text.gif) | tuberculosis-pada-anak.html | 2026-08-10 02:09 | 118K | |
![[TXT]](/icons/text.gif) | nytimes.com- Failure of Herstatt Disturbs Banking- By Clyde H. Farnsworth Special to The New York Times.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | devops-roket-insurtech.html | 2026-08-10 02:09 | 44K | |
![[TXT]](/icons/text.gif) | dari-kenaikan-yang-rapuh-menuju-krisis-kepercayaan-ketika-ihsg-kehilangan-fondasinya.html | 2026-08-10 02:09 | 44K | |
![[TXT]](/icons/text.gif) | bot-trading-vs-manual-trading.html | 2026-08-10 02:09 | 50K | |
![[TXT]](/icons/text.gif) | akankah-kota-pompeii-mendapatkan-pembayaran-klaim-asuransi-terbesar-sepanjang-masa-akibat-letusan-gunung-vesuvius.html | 2026-08-10 02:09 | 46K | |
![[TXT]](/icons/text.gif) | Wilson, K. L. (2020). Underwriting Criteria, Practices, and Tools of Pet Health Insurance Companies. Conn. Ins. LJ, 27, 359.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Peraturan Pemerintah No-2.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Mulpiani, W. (2019). Pengaruh Pengungkapan Sustainability Report Terhadap Kinerja Perusahaan Publik di Indonesia. Jurnal Studi Akuntansi dan Keuangan Vol.html | 2026-08-10 02:09 | 4.4K | |
![[TXT]](/icons/text.gif) | Ainurrohmah, S., & Sudarti, S. (2022). Analisa Perubahan Iklim dan Global Warming yang Terjadi sebagai Fase Kritis. Jurnal Phi, 1-10.html | 2026-08-10 02:09 | 4.4K | |
![[DIR]](/icons/folder.gif) | Tamplin, T. (2023) Hole-In-One Insurance _ Def/ | 2026-08-09 21:46 | - | |
![[ ]](/icons/unknown.gif) | Zulfita, E., & Syarvina, W. (2022). Analysis of the Implementation of the Work Accident Insurance Program at the Office of BPJS Ketenagakerjaan, Binjai Branch. Jurnal Akuntansi, Man | 2026-08-09 21:46 | 4.4K | |
![[DIR]](/icons/folder.gif) | Zhai, X., Ji, Q., Wu, F. (2024). Climate-Driven/ | 2026-08-09 21:46 | - | |
![[DIR]](/icons/folder.gif) | World Meteorological Organization, n.d. Tropica/ | 2026-08-09 21:46 | - | |
![[DIR]](/icons/folder.gif) | World Health Organization (WHO). (2025–2026). G/ | 2026-08-09 21:46 | - | |
![[DIR]](/icons/folder.gif) | World Health Organization (WHO) (2025). Measles. Retrieved from https_/ | 2026-08-09 21:46 | - | |
![[DIR]](/icons/folder.gif) | World Bank (2024). Indonesia Health System Stre/ | 2026-08-09 21:46 | - | |
![[DIR]](/icons/folder.gif) | World Animal Protection Organization (2015). Japan Animal Protection Profile. Retrieved from https_/ | 2026-08-09 21:46 | - | |
![[DIR]](/icons/folder.gif) | Willis Towers Watson (WTW) (2025). Asia Pacific/ | 2026-08-09 21:46 | - | |
![[DIR]](/icons/folder.gif) | Willis Towers Watson (WTW) (2025). 2026 Global Medical Trends Survey. Retrieved from https_/ | 2026-08-09 21:46 | - | |
![[ ]](/icons/unknown.gif) | Williams, A., Williams, B., Hansen, C. R., & Coble, K. H. (2020). The impact of pet health insurance on dog owners’ spending for veterinary services. Animals, 10(7), 1162.13bf.delay | 2026-08-09 21:46 | 4.4K | |
![[DIR]](/icons/folder.gif) | UNSGSA, Briefing on Regulatory Sandboxes, https_/ | 2026-08-09 21:45 | - | |
![[DIR]](/icons/folder.gif) | Universitas Muhammadiyah Surakarta (UMS). (2026/ | 2026-08-09 21:45 | - | |
![[DIR]](/icons/folder.gif) | U.S.NRC. 2018. Knowledge and Abilities Catalog/ | 2026-08-09 21:45 | - | |
![[DIR]](/icons/folder.gif) | U.S. Department of Energy. 2021. Fission and Fu/ | 2026-08-09 21:45 | - | |
![[DIR]](/icons/folder.gif) | U.S. Department of Energy. 2019. The Ultimate F/ | 2026-08-09 21:45 | - | |
![[DIR]](/icons/folder.gif) | U.S. Department of Energy. (2021). Fuel cell el/ | 2026-08-09 21:45 | - | |
![[DIR]](/icons/folder.gif) | Type 5 diabetes is a newly recognised disease –/ | 2026-08-09 21:45 | - | |
![[DIR]](/icons/folder.gif) | Torpey, Daniel. 2019. Contingent Business Inter/ | 2026-08-09 21:45 | - | |
![[DIR]](/icons/folder.gif) | Times Indonesia (2025). 112 Pasar Rakyat Lumpuh/ | 2026-08-09 21:45 | - | |
![[DIR]](/icons/folder.gif) | Terhorst, A., Lusher, D., Bolton, D., Elsum, I/ | 2026-08-09 21:45 | - | |
![[DIR]](/icons/folder.gif) | Tempo English. (2026). Super Flu Alert_ How It/ | 2026-08-09 21:45 | - | |
![[DIR]](/icons/folder.gif) | Taufani, M.R.I, 2023. RI Panas Mendidih, Rekor/ | 2026-08-09 21:45 | - | |
![[ ]](/icons/unknown.gif) | Tanc, A., Arat, H. T., Baltacioglu, E., & Aydin, K. (2019). Overview of the next quarter century vision of hydrogen fuel cell electric vehicles. International Journal of Hydrogen En | 2026-08-09 21:45 | 4.4K | |
![[DIR]](/icons/folder.gif) | Swiss Re. (2021). Business Interruption Insuran/ | 2026-08-09 21:45 | - | |
![[DIR]](/icons/folder.gif) | Suryaningsih, Lilik. 2020. Peranan Asuransi Dalam Pengiriman Barang Impor Menggunakan Air Freight Forwarding, https_/ | 2026-08-09 21:45 | - | |
![[DIR]](/icons/folder.gif) | Suriastini et al. (2022). Longitudinal Outcomes/ | 2026-08-09 21:45 | - | |
![[DIR]](/icons/folder.gif) | Surat Edaran Otoritas Jasa Keuangan Nomor 6/ | 2026-08-09 21:45 | - | |
![[ ]](/icons/unknown.gif) | Sukono, S., Susanti, D., Ridwan, F., Riaman, R., Hertini, E., & Saputra, J. (2023). Analyzing the community decision making to purchase pet insurance_ Case study of animal lovers in | 2026-08-09 21:45 | 4.4K | |
![[DIR]](/icons/folder.gif) | Statistik Penduduk Lanjut Usia 2024 (2024) Bada/ | 2026-08-09 21:45 | - | |
![[DIR]](/icons/folder.gif) | Statista. 2022. Distributio of Electricity Gene/ | 2026-08-09 21:45 | - | |
![[ ]](/icons/unknown.gif) | SKKNI 2019 tentang Penetapan Standar Kompetensi Kerja Nasional Indonesia Kategori Industri Pengolahan Golongan Pokok Industri Bahan Kimia dan Barang dari Bahan Kimia Bidang Industri | 2026-08-09 21:45 | 4.4K | |
![[ ]](/icons/unknown.gif) | Shodiqin, D. H. (2021). Sosialisasi CIKUR (Ciri-Ciri Keaslian Rupiah) Tahun Emisi 2016 untuk Menghambat Peredaran Uang Palsu. Mujtama’ Jurnal Pengabdian Masyarakat, 1(1), 47–56.18ac | 2026-08-09 21:45 | 4.4K | |
![[ ]](/icons/unknown.gif) | Septiansyah, D. A., Wuryaningsih, E. W., & Deviantony, F. (2023) Relationship between Health Insurance and Compliance with Access to Health Services for Patients with Severe Mental | 2026-08-09 21:45 | 4.4K | |
![[DIR]](/icons/folder.gif) | Sekretariat Kabinet Republik Indonesia, BPOM Te/ | 2026-08-09 21:45 | - | |
![[DIR]](/icons/folder.gif) | scijinks.gov, n.d. how do Hurricanes form. [Online] Available at_ https_/ | 2026-08-09 21:45 | - | |
![[DIR]](/icons/folder.gif) | Saini, M., Arif, M., & Kulonda, D. J. (2018). C/ | 2026-08-09 21:45 | - | |
![[DIR]](/icons/folder.gif) | Safitri, A & Meilano, I & Gunawan, Endra & Abid/ | 2026-08-09 21:45 | - | |
![[ ]](/icons/unknown.gif) | Rianda, C. N. (2021). Analysis of Bitcoin's Impact on Users and Their Impact on the Value of the Rupiah and the Role of the Government in the Presence of Bitcoin. Jurnal Ilmiah Teun | 2026-08-09 21:45 | 4.4K | |
![[DIR]](/icons/folder.gif) | Reuters. (2026). U.S. Flu Season Update and Hos/ | 2026-08-09 21:45 | - | |
![[DIR]](/icons/folder.gif) | Redwoodlogistics.com. The History of Freight Forwarding, https_/ | 2026-08-09 21:45 | - | |
![[DIR]](/icons/folder.gif) | Red Asia Insurance, https_/ | 2026-08-09 21:45 | - | |
![[ ]](/icons/unknown.gif) | Rasyid, M. R. (2020). Perancangan Informasi Mata Uang Rupiah untuk Anak Berkebutuhan Khusus Tunagrahita Ringan melalui Media Game Berbasis Android. Universitas Komputer Indonesia.18 | 2026-08-09 21:45 | 4.4K | |
![[DIR]](/icons/folder.gif) | Rakuten Insight. (n.d.). Pet ownership in Asia. https_/ | 2026-08-09 21:45 | - | |
![[ ]](/icons/unknown.gif) | Rahmah, R. H., & Indrawati, F. (2024). Analyzing Utilization Of Mental Health Services for National Health Insurance Participants in Indonesia. Unnes Journal of Public Health, 13(1) | 2026-08-09 21:44 | 4.4K | |
![[DIR]](/icons/folder.gif) | Pusat Krisis Kemenkes (2025). Waspadai Penyakit Pasca Banjir. Retrieved from https_/ | 2026-08-09 21:44 | - | |
![[DIR]](/icons/folder.gif) | Puppet, “The 2021 State of DevOps Report”, https_/ | 2026-08-09 21:44 | - | |
![[DIR]](/icons/folder.gif) | PT. Liberty & General Risk Services. 2023. Glosari Category_ Freight forwarder Liability, https_/ | 2026-08-09 21:44 | - | |
![[ ]](/icons/unknown.gif) | PT Reasuransi Indonesia Utama (Persero). Investor Relations – Monthly Financial Report. Laporan Keuangan Bulanan Bukan Konsolidasi PT Reasuransi Indonesia Utama (Persero) per Desemb | 2026-08-09 21:44 | 4.4K | |
![[DIR]](/icons/folder.gif) | Preston, L. A. (2003). Intraslab Earthquakes_ Dehydration of the Cascadia Slab. Science, 302(5648), 1197–1200. doi_10.1126/ | 2026-08-09 21:44 | - | |
![[DIR]](/icons/folder.gif) | POJK No.37/ | 2026-08-09 21:44 | - | |
![[DIR]](/icons/folder.gif) | Perjalanan Wabah Antraks di Indonesia Sejak 1832 Available at_ https_/ | 2026-08-09 21:44 | - | |
![[ ]](/icons/unknown.gif) | Peraturan Otoritas Jasa Keuangan tentang Perizinan Usaha dan Kelembagaan Perusahaan Asuransi, Perusahaan Asuransi Syariah, Perusahaan Reasuransi, dan Perusahaan Reasuransi Syariah-2 | 2026-08-09 21:44 | 4.4K | |
![[ ]](/icons/unknown.gif) | Peraturan Otoritas Jasa Keuangan tentang Perizinan Usaha dan Kelembagaan Perusahaan Asuransi, Perusahaan Asuransi Syariah, Perusahaan Reasuransi, dan Perusahaan Reasuransi Syariah | 2026-08-09 21:44 | 4.4K | |
![[DIR]](/icons/folder.gif) | Penyakit Anthrax Kembali Muncul di Gunungkidul,/ | 2026-08-09 21:44 | - | |
![[DIR]](/icons/folder.gif) | Paradigm, V. (2023). Business Process Improveme/ | 2026-08-09 21:44 | - | |
![[ ]](/icons/unknown.gif) | Otoritas Jasa Keuangan. (2023). Peraturan Otoritas Jasa Keuangan Nomor 5 Tahun 2023 tentang Perizinan Usaha dan Kelembagaan Perusahaan Asuransi, Perusahaan Asuransi Syariah, Perusah | 2026-08-09 21:44 | 4.4K | |
![[DIR]](/icons/folder.gif) | Otoritas Jasa Keuangan. (2017). Surat Edaran Ot/ | 2026-08-09 21:44 | - | |
![[DIR]](/icons/folder.gif) | Otoritas Jasa Keuangan (OJK)_ Tata Kelola Kecer/ | 2026-08-09 21:44 | - | |
![[DIR]](/icons/folder.gif) | Osmosis. (2025). Rhabdomyolysis. https_/ | 2026-08-09 21:44 | - | |
![[ ]](/icons/unknown.gif) | Okrepilov, V. V., Kovalenko, B. B., Getmanova, G. V., & Turovskaj, M. S. (2020). Business process transformation_ impact mobile technology and social networks on the business dynami | 2026-08-09 21:44 | 4.4K | |
![[DIR]](/icons/folder.gif) | OJK Regulation No. 13/ | 2026-08-09 21:44 | - | |
![[DIR]](/icons/folder.gif) | OJK Circular Letter No. 21/ | 2026-08-09 21:44 | - | |
![[DIR]](/icons/folder.gif) | Nurmala, N., 2018. Mengulik Kisah Ironis Minyak/ | 2026-08-09 21:44 | - | |
![[DIR]](/icons/folder.gif) | Nurhanisah, Yuli. 2003. Fenomena EL NINO & Indian Ocean Dipole (IOD). Diakses pada 16 Oktober 2023 melalui indonesiabaik.id/ | 2026-08-09 21:44 | - | |
![[DIR]](/icons/folder.gif) | Nuclear Reactor Laboratory Massachusetts Institute of Technology. 2023. Reactor. Diakses pada 01 November 2023 melalui https_/ | 2026-08-09 21:44 | - | |
![[DIR]](/icons/folder.gif) | NS Energy. 2018. Types of nuclear waste that re/ | 2026-08-09 21:44 | - | |
![[TXT]](/icons/text.gif) | Nonaka, I and Hirotaka Takuchi . (1995). The Knowledge- Creating Company. New York. Oxford University Press. Rumanti, A. A. (n.d.). (2011). ANALISIS MODEL TRANSFER TACIT KNOWLEDGE_ | 2026-08-09 21:44 | 4.4K | |
![[DIR]](/icons/folder.gif) | NHK World – Japan. 2023. Japan begins releasing/ | 2026-08-09 21:44 | - | |
![[DIR]](/icons/folder.gif) | National Geographic. 2023. Diakses pada 30 Oktober 2023 melalui https_/ | 2026-08-09 21:43 | - | |
![[DIR]](/icons/folder.gif) | NASA, 2019. How do Hurricanes form. [Online] Available at_ https_/ | 2026-08-09 21:43 | - | |
![[DIR]](/icons/folder.gif) | Munich Re. (2023). Claims Perspective on Busine/ | 2026-08-09 21:43 | - | |
![[DIR]](/icons/folder.gif) | MetLife Pet Insurance. (n.d.). How pet insurance works. https_/ | 2026-08-09 21:43 | - | |
![[DIR]](/icons/folder.gif) | Media Asuransi. (2023). 44 Best Insurance 2023/ | 2026-08-09 21:43 | - | |
![[DIR]](/icons/folder.gif) | McGrath, M., 2021. Climate change_ Huge toll of/ | 2026-08-09 21:43 | - | |
![[DIR]](/icons/folder.gif) | Maruf, R. 2023. Moody’s estimates Hawaiian wild/ | 2026-08-09 21:43 | - | |
![[DIR]](/icons/folder.gif) | Manoharan, Y., Hosseini, S. E., Butler, B., Alz/ | 2026-08-09 21:43 | - | |
![[DIR]](/icons/folder.gif) | Manajemen resiko/ | 2026-08-09 21:43 | - | |
![[DIR]](/icons/folder.gif) | Malnutrition-Related Diabetes Officially Named/ | 2026-08-09 21:43 | - | |
![[DIR]](/icons/folder.gif) | MacKerron, Gordon. 2019. Future Prospects on Co/ | 2026-08-09 21:43 | - | |
![[ ]](/icons/unknown.gif) | Lubis, M., & Rokhim, R. (2021). The Effect of Environmental, Social, and Governance (ESG) Disclosure and Competitive Advantage on Companies Performance as An Implementation of Susta | 2026-08-09 21:43 | 4.4K | |
![[ ]](/icons/unknown.gif) | Lawrence, W., Tarr, J. A., Brook, N., Chaperon, M., & Sorel, A. (2024). Parametric Insurance. In The Global Insurance Market and Change (pp. 127-156). Informa Law from Routledge.13e | 2026-08-09 21:43 | 4.4K | |
![[DIR]](/icons/folder.gif) | Kontan.co.id. (2025, 2 Desember). Terkontraksi/ | 2026-08-09 21:43 | - | |
![[DIR]](/icons/folder.gif) | Kompas. 2024. Toyota Recall Justri Buat Dukung/ | 2026-08-09 21:43 | - | |
![[DIR]](/icons/folder.gif) | Kompas (2026). Campak Juga Terjadi pada Usia De/ | 2026-08-09 21:43 | - | |
![[DIR]](/icons/folder.gif) | Khadka, N.S. 2023. The science behind the Fukushima waste water release. Diakses pada 01 November 2023 melalui https_/ | 2026-08-09 21:42 | - | |
![[DIR]](/icons/folder.gif) | Kennedys-Chubb , Emerging Risk in Covid-19 Clin/ | 2026-08-09 21:42 | - | |
![[DIR]](/icons/folder.gif) | Kementerian Lingkungan Hidup dan Kehutanan, 2017. REDD+. [Online] Available at_ http_/ | 2026-08-09 21:42 | - | |
![[DIR]](/icons/folder.gif) | Kementerian Lingkungan Hidup dan Kehutanan, 201/ | 2026-08-09 21:42 | - | |
![[DIR]](/icons/folder.gif) | Kementerian Komunikasi dan Informatika Republik/ | 2026-08-09 21:42 | - | |
![[DIR]](/icons/folder.gif) | Kementerian Kesehatan RI, Tingkatkan Kemampuan/ | 2026-08-09 21:42 | - | |
![[DIR]](/icons/folder.gif) | Kementerian Kesehatan Republik Indonesia. (2025/ | 2026-08-09 21:42 | - | |
![[DIR]](/icons/folder.gif) | Kementerian Kesehatan (2026). Waspada Campak Je/ | 2026-08-09 21:42 | - | |
![[DIR]](/icons/folder.gif) | Kementerian Kesehatan (2025). Kematian 20 Anak/ | 2026-08-09 21:42 | - | |
![[DIR]](/icons/folder.gif) | Kanamori, Hiroo (1994) Mechanics of earthquakes. Annual Review of Earth and Planetary Sciences, 22 . pp. 207-237. ISSN 0084-6597. doi_10.1146/ | 2026-08-09 21:42 | - | |
![[DIR]](/icons/folder.gif) | Investopedia. (n.d.). Pet insurance_ An experienced veterinarian’s perspective. https_/ | 2026-08-09 21:42 | - | |
![[DIR]](/icons/folder.gif) | International Union of Marine Insurance. (2025)/ | 2026-08-09 21:42 | - | |
![[DIR]](/icons/folder.gif) | Insurance2day. (2021). Business Interruption In/ | 2026-08-09 21:42 | - | |
![[DIR]](/icons/folder.gif) | Insurance Information Institute. (n.d.). Spotlight on dog bite liability. https_/ | 2026-08-09 21:42 | - | |
![[ ]](/icons/unknown.gif) | Institution of Social Security employment (2015) ‘Peraturan Badan Penyelenggara Jaminan Sosial Ketenagakerjaan Nomor 3 Tahun 2015’. Jakarta_ Direktur Jenderal Peraturan PerundangUnd | 2026-08-09 21:42 | 4.4K | |
![[DIR]](/icons/folder.gif) | Institute for Energy and Environmental Research/ | 2026-08-09 21:42 | - | |
![[DIR]](/icons/folder.gif) | Imuni (2026). DARURAT! Update Kasus Campak di Indonesia. Retrieved from https_/ | 2026-08-09 21:42 | - | |
![[DIR]](/icons/folder.gif) | IDF Launches New Type 5 Diabetes Working Group Available at_ https_/ | 2026-08-09 21:42 | - | |
![[DIR]](/icons/folder.gif) | IAEA. 2021. Nuclear Power Reactors in the World. Diakses pada 02 Januari 2024 melalui https_/ | 2026-08-09 21:42 | - | |
![[ ]](/icons/unknown.gif) | Husada, E. V., & Handayani, S. (2021). Pengaruh Pengungkapan ESG Terhadap Kinerja Keuangan Perusahaan (Studi Empiris Pada Perusahaan Sektor Keuangan yang Terdaftar di BEI Periode 20 | 2026-08-09 21:42 | 4.4K | |
![[DIR]](/icons/folder.gif) | Hung, C. -., Chan, P. -., Lin, C. -., & Lin, M/ | 2026-08-09 21:42 | - | |
![[DIR]](/icons/folder.gif) | Hukum Online, Tentang Surety Bond, diakses pada 2 Juli 2024 melalui https_/ | 2026-08-09 21:42 | - | |
![[DIR]](/icons/folder.gif) | Horne, B., Hooson, M. (2024) Our Pick of the Best Gadget Insurance, Forbes. Diakses pada tanggal 8 Mei 2024 melalui https_/ | 2026-08-09 21:42 | - | |
![[DIR]](/icons/folder.gif) | Henisz, W., Koller, T., & Nuttall, R. (2019, No/ | 2026-08-09 21:42 | - | |
![[ ]](/icons/unknown.gif) | Hapsari, W., Natassia, K. and Riniasih, W. (2019) ‘Analisis Minat Masyarakat Dalam Keikutsertaan Bpjs Kesehatan Di Kecamatan Gabus Kabupaten Grobogan’, Seminar Nasional UNRIYO, pp | 2026-08-09 21:42 | 4.4K | |
![[DIR]](/icons/folder.gif) | Hantavirus Available at_ https_/ | 2026-08-09 21:42 | - | |
![[DIR]](/icons/folder.gif) | Halodoc (2020). Campak. Retrieved from https_/ | 2026-08-09 21:42 | - | |
![[ ]](/icons/unknown.gif) | Gymnastiar, I. A., et al. (2024). RUPIAH Currency Introduction Program for Children of Migrant Workers in Malaysia. Jurnal Pengabdian Kolaborasi dan Inovasi IPTEKS, 2(3), 1010-1019 | 2026-08-09 21:42 | 4.4K | |
![[DIR]](/icons/folder.gif) | Gulen, K. (2023, February 6). Mastering the art/ | 2026-08-09 21:42 | - | |
![[DIR]](/icons/folder.gif) | Guan, X., Feng, C., & Zhang, J. (2020). Risk as/ | 2026-08-09 21:42 | - | |
![[DIR]](/icons/folder.gif) | Grossi, P., Kunreuther, H., Windeler, D. (2005)/ | 2026-08-09 21:42 | - | |
![[DIR]](/icons/folder.gif) | Golubyatnikov, J.J., Zakshevskii, V.G., Victor/ | 2026-08-09 21:42 | - | |
![[DIR]](/icons/folder.gif) | Gambar Thumbnail. https_/ | 2026-08-09 21:42 | - | |
![[DIR]](/icons/folder.gif) | Gallagher, J. Larissa, Burg, Michael. 2022. Con/ | 2026-08-09 21:41 | - | |
![[DIR]](/icons/folder.gif) | Fi-Greg. (2023), “10 Biggest Insurance Claim Pa/ | 2026-08-09 21:41 | - | |
![[DIR]](/icons/folder.gif) | Fahamsyah, E., Hariyani, I., & Rimba, A. (2020). Regulating pet insurance in Indonesia. Lentera Hukum, 7(1), 55–68. https_/ | 2026-08-09 21:41 | - | |
![[DIR]](/icons/folder.gif) | European Insurance and Occupational Pensions Au/ | 2026-08-09 21:41 | - | |
![[DIR]](/icons/folder.gif) | Direktorat Jenderal Mineral dan Batubara, Kemen/ | 2026-08-09 21:41 | - | |
![[DIR]](/icons/folder.gif) | Diabetes Available at_ https_/ | 2026-08-09 21:41 | - | |
![[DIR]](/icons/folder.gif) | Detik Finance (2025). Pemerintah Mau Hapus Utan/ | 2026-08-09 21:41 | - | |
![[DIR]](/icons/folder.gif) | Detik Finance (2025). OJK Teken Aturan Keringan/ | 2026-08-09 21:41 | - | |
![[DIR]](/icons/folder.gif) | Depkes. (2014). Stop Stigma dan Diskriminasi t/ | 2026-08-09 21:41 | - | |
![[DIR]](/icons/folder.gif) | Deepseek AI Watershed Moment https_/ | 2026-08-09 21:41 | - | |
![[DIR]](/icons/folder.gif) | CNN Indonesia. 2023. Pemasok Utama Dunia, India/ | 2026-08-09 21:41 | - | |
![[DIR]](/icons/folder.gif) | CNN Indonesia. 2019. Membandingkan Karhutla di/ | 2026-08-09 21:41 | - | |
![[DIR]](/icons/folder.gif) | CNN Indonesia (2025). Presiden Akan Hapus Utang/ | 2026-08-09 21:41 | - | |
![[DIR]](/icons/folder.gif) | CNCB Indonesia. 2023. Sah! Putin Resmi Main Sen/ | 2026-08-09 21:41 | - | |
![[DIR]](/icons/folder.gif) | Chartered Institute of Loss Adjusters (CILA). (2023). Business Interruption Cover Issues. [PDF]. Diakses dari_ https_/ | 2026-08-09 21:41 | - | |
![[DIR]](/icons/folder.gif) | Centers for Disease Control and Prevention (CDC). (2025–2026). Seasonal Influenza Activity and Surveillance Reports. Retrieved from_ https_/ | 2026-08-09 21:41 | - | |
![[DIR]](/icons/folder.gif) | Centers for Disease Control and Prevention (CDC) (2024). Measles (Rubeola). Retrieved from https_/ | 2026-08-09 21:41 | - | |
![[DIR]](/icons/folder.gif) | Cegah Antraks Meluas, Kemenkes Beri Profilaksis/ | 2026-08-09 21:41 | - | |
![[DIR]](/icons/folder.gif) | CDC (2024). About Nipah Virus. Retrieved from https_/ | 2026-08-09 21:41 | - | |
![[DIR]](/icons/folder.gif) | Cancer Research UK, Safety in Clinical Trials (/ | 2026-08-09 21:41 | - | |
![[DIR]](/icons/folder.gif) | Bursa Efek Indonesia. (2015). Panduan IPO Go Public. Diakses pada Desember 2023. https_/ | 2026-08-09 21:41 | - | |
![[DIR]](/icons/folder.gif) | Bradbury Science. 2022. Little Boy Fat Man. Diakses pada 30 Oktober 2023 melalui https_/ | 2026-08-09 21:41 | - | |
![[DIR]](/icons/folder.gif) | BPJS Ketenagakerjaan. (2024). Kecelakaan Kerja/ | 2026-08-09 21:41 | - | |
![[DIR]](/icons/folder.gif) | BMKG. 2023. Potensi Wilayah Terdampak El Nino. Diakses pada 16 Oktober 2023 melalui www.bmkg.go.id/ | 2026-08-09 21:41 | - | |
![[DIR]](/icons/folder.gif) | Bisnis.com, 2021. Semester I/ | 2026-08-09 21:41 | - | |
![[DIR]](/icons/folder.gif) | Berraies, S., Hamza, K. A., & Chtioui, R. (2020/ | 2026-08-09 21:41 | - | |
![[DIR]](/icons/folder.gif) | Baur, Dirk G. and Smales, Lee A., Gold and Geopolitical Risk (January 24, 2018). https_/ | 2026-08-09 21:41 | - | |
![[DIR]](/icons/folder.gif) | Basaria et al. (2023). Infectious Diseases Following Hydrometeorological Disasters. Retrieved from https_/ | 2026-08-09 21:41 | - | |
![[DIR]](/icons/folder.gif) | Bakteri Mematikan, Thailand Catat Kematian Pert/ | 2026-08-09 21:41 | - | |
![[DIR]](/icons/folder.gif) | Auto2000. 2021. Auto2000. Retrieved from Mengenali Water Hammer pada Mobil dan Cara Mencegahnya_ https_/ | 2026-08-09 21:40 | - | |
![[DIR]](/icons/folder.gif) | Asosiasi Asuransi Umum Indonesia. (2025). Book Q3-25 Web [Laporan triwulan]. Diakses dari https_/ | 2026-08-09 21:40 | - | |
![[DIR]](/icons/folder.gif) | Aon (2026). The Global Medical Trend Rates Report 2026. Retrieved from https_/ | 2026-08-09 21:40 | - | |
![[DIR]](/icons/folder.gif) | Antraks Available at_ https_/ | 2026-08-09 21:40 | - | |
![[DIR]](/icons/folder.gif) | Antara (2025). OJK sebut daerah Sumatera terdam/ | 2026-08-09 21:40 | - | |
![[DIR]](/icons/folder.gif) | Analisis Profil Penduduk Indonesia (2022) Badan/ | 2026-08-09 21:40 | - | |
![[DIR]](/icons/folder.gif) | American Pet Products Association. (n.d.). Industry trends and stats. https_/ | 2026-08-09 21:40 | - | |
![[DIR]](/icons/folder.gif) | Alodokter. 2023. 9 Manfaat Bunga Telang untuk Kesehatan Tubuh. Diakses pada 06 Mei 2024 melalui https_/ | 2026-08-09 21:40 | - | |
![[DIR]](/icons/folder.gif) | Alodokter. 2022. 5 Manfaat Flavonoid untuk Kesehatan. Diakses pada 06 Mei 2024 melalui https_/ | 2026-08-09 21:40 | - | |
![[DIR]](/icons/folder.gif) | Alodokter (2025). Bahaya Virus Nipah dan Potensinya Menjadi Pandemi Baru. Retrieved from https_/ | 2026-08-09 21:40 | - | |
![[ ]](/icons/unknown.gif) | Alfiansah, Y., Kurniawan, B., & Ekawati, E. (2020). Analisis Upaya Manajemen K3 Dalam Pencegahan Dan Pengendalian Kecelakaan Kerja Pada Proyek Konstruksi PT. X Semarang. Jurnal kese | 2026-08-09 21:40 | 4.4K | |
![[DIR]](/icons/folder.gif) | Ageing and Health (2024) WHO Available at_ https_/ | 2026-08-09 21:40 | - | |
![[ ]](/icons/unknown.gif) | Adib, A. Z., Riaman, R., & Subartini, B. (2024). Analysis of Pet Owners' Willingness to Pay for Pet Insurance Premiums in DKI Jakarta Using Logistic Regression Model. International | 2026-08-09 21:40 | 4.4K | |
![[DIR]](/icons/folder.gif) | About Hantavirus Available at_ https_/ | 2026-08-09 21:40 | - | |
![[DIR]](/icons/folder.gif) | Abdul Basit, S., & Medase, K. (2019). The diver/ | 2026-08-09 21:40 | - | |
![[DIR]](/icons/folder.gif) | AAUI. 2009. WORDING PSAKBI 12/ | 2026-08-09 21:40 | - | |
![[DIR]](/icons/folder.gif) | A, Rizki Dewi. (2023). Mengenal Aturan Modal Mi/ | 2026-08-09 21:40 | - | |
![[DIR]](/icons/folder.gif) | -Permen BUMN NOMOR PER-05/ | 2026-08-09 21:40 | - | |
|